| VIS ID | Virus | Ensembl ID | Gene Type | Target Gene | Oncogene | Tumor Suppressor Gene | NCBI ID | Uniprot ID |
|---|---|---|---|---|---|---|---|---|
| TVIS20011855 | HPV | ENSG00000134640.3 | protein_coding | MTNR1B | No | No | 4544 | P49286 |
Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | MTNR1B |
|---|---|
| DrugBank ID | DB06594 |
| Drug Name | Agomelatine |
| Target ID | BE0000327 |
| UniProt ID | P49286 |
| Regulation Type | agonist |
| PubMed IDs | 15289999 |
| Citations | Millan MJ, Brocco M, Gobert A, Dekeyne A: Anxiolytic properties of agomelatine, an antidepressant with melatoninergic and serotonergic properties: role of 5-HT2C receptor blockade. Psychopharmacology (Berl). 2005 Feb;177(4):448-58. Epub 2004 Jul 31. |
| Groups | Approved; Investigational |
| Direct Classification | N-acetyl-2-arylethylamines |
| SMILES | COC1=CC2=C(CCNC(C)=O)C=CC=C2C=C1 |
| Pathways | |
| PharmGKB | PA165958363 |
| ChEMBL | CHEMBL10878 |
