| VIS ID | Virus | Ensembl ID | Gene Type | Target Gene | Oncogene | Tumor Suppressor Gene | NCBI ID | Uniprot ID |
|---|---|---|---|---|---|---|---|---|
| TVIS20031141 | HPV | ENSG00000159164.10 | protein_coding | SV2A | No | No | 9900 | Q7L0J3 |
Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | SV2A |
|---|---|
| DrugBank ID | DB05885 |
| Drug Name | Seletracetam |
| Target ID | BE0000993 |
| UniProt ID | Q7L0J3 |
| Regulation Type | modulator |
| PubMed IDs | 17199025; 18183537 |
| Citations | Bennett B, Matagne A, Michel P, Leonard M, Cornet M, Meeus MA, Toublanc N: Seletracetam (UCB 44212). Neurotherapeutics. 2007 Jan;4(1):117-22.@@Pollard JR: Seletracetam, a small molecule SV2A modulator for the treatment of epilepsy. Curr Opin Investig Drugs. 2008 Jan;9(1):101-7. |
| Groups | Investigational |
| Direct Classification | Alpha amino acids and derivatives |
| SMILES | CC[C@H](N1C[C@@H](CC1=O)C=C(F)F)C(N)=O |
| Pathways | |
| PharmGKB | |
| ChEMBL | CHEMBL3918017 |
