| VIS ID | Virus | Ensembl ID | Gene Type | Target Gene | Oncogene | Tumor Suppressor Gene | NCBI ID | Uniprot ID |
|---|---|---|---|---|---|---|---|---|
| TVIS10020832 | HBV | ENSG00000197894.12 | protein_coding | ADH5 | No | No | 128 | P11766 Q6IRT1 |
| TVIS44004455 | HTLV-1 | ENSG00000197894.12 | protein_coding | ADH5 | No | No | 128 | P11766 Q6IRT1 |
Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | ADH5 |
|---|---|
| DrugBank ID | DB04153 |
| Drug Name | S-Hydroxymethyl Glutathione |
| Target ID | BE0000009 |
| UniProt ID | P11766 |
| Regulation Type | |
| PubMed IDs | 17139284; 17016423 |
| Citations | Overington JP, Al-Lazikani B, Hopkins AL: How many drug targets are there? Nat Rev Drug Discov. 2006 Dec;5(12):993-6.@@Imming P, Sinning C, Meyer A: Drugs, their targets and the nature and number of drug targets. Nat Rev Drug Discov. 2006 Oct;5(10):821-34. |
| Groups | Experimental |
| Direct Classification | Oligopeptides |
| SMILES | N[C@@H](CCC(=O)N[C@@H](CSCO)C(=O)NCC(O)=O)C(O)=O |
| Pathways | |
| PharmGKB | |
| ChEMBL |
