| VIS ID | Virus | Ensembl ID | Gene Type | Target Gene | Oncogene | Tumor Suppressor Gene | NCBI ID | Uniprot ID |
|---|---|---|---|---|---|---|---|---|
| TVIS30083001 | HIV | ENSG00000142208.19 | protein_coding | AKT1 | Yes | No | 207 | B0LPE5 P31749 |
| TVIS30037657 | HIV | ENSG00000142208.19 | protein_coding | AKT1 | Yes | No | 207 | B0LPE5 P31749 |
| TVIS30037658 | HIV | ENSG00000142208.19 | protein_coding | AKT1 | Yes | No | 207 | B0LPE5 P31749 |
Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | AKT1 |
|---|---|
| DrugBank ID | DB01863 |
| Drug Name | Inositol 1,3,4,5-Tetrakisphosphate |
| Target ID | BE0000428 |
| UniProt ID | P31749 |
| Regulation Type | |
| PubMed IDs | 17139284; 17016423 |
| Citations | Overington JP, Al-Lazikani B, Hopkins AL: How many drug targets are there? Nat Rev Drug Discov. 2006 Dec;5(12):993-6.@@Imming P, Sinning C, Meyer A: Drugs, their targets and the nature and number of drug targets. Nat Rev Drug Discov. 2006 Oct;5(10):821-34. |
| Groups | Experimental |
| Direct Classification | Inositol phosphates |
| SMILES | O[C@H]1[C@@H](OP(O)(O)=O)[C@H](O)[C@@H](OP(O)(O)=O)[C@H](OP(O)(O)=O)[C@H]1OP(O)(O)=O |
| Pathways | |
| PharmGKB | |
| ChEMBL | CHEMBL23552 |
