| VIS ID | Virus | Ensembl ID | Gene Type | Target Gene | Oncogene | Tumor Suppressor Gene | NCBI ID | Uniprot ID |
|---|---|---|---|---|---|---|---|---|
| TVIS30077139 | HIV | ENSG00000143179.16 | protein_coding | UCK2 | No | No | 7371 | Q9BZX2 |
Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | UCK2 |
|---|---|
| DrugBank ID | DB04005 |
| Drug Name | Uridine 5'-triphosphate |
| Target ID | BE0001480 |
| UniProt ID | Q9BZX2 |
| Regulation Type | |
| PubMed IDs | 17139284; 17016423 |
| Citations | Overington JP, Al-Lazikani B, Hopkins AL: How many drug targets are there? Nat Rev Drug Discov. 2006 Dec;5(12):993-6.@@Imming P, Sinning C, Meyer A: Drugs, their targets and the nature and number of drug targets. Nat Rev Drug Discov. 2006 Oct;5(10):821-34. |
| Groups | Experimental; Investigational |
| Direct Classification | Pyrimidine ribonucleoside triphosphates |
| SMILES | O[C@H]1[C@@H](O)[C@@H](O[C@@H]1COP(O)(=O)OP(O)(=O)OP(O)(O)=O)N1C=CC(=O)NC1=O |
| Pathways | |
| PharmGKB | |
| ChEMBL | CHEMBL336296 |
