Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | TP53 |
|---|---|
| DrugBank ID | DB14487 |
| Drug Name | Zinc acetate |
| Target ID | BE0003380 |
| UniProt ID | P04637 |
| Regulation Type | |
| PubMed IDs | 17327663 |
| Citations | Wang Y, Rosengarth A, Luecke H: Structure of the human p53 core domain in the absence of DNA. Acta Crystallogr D Biol Crystallogr. 2007 Mar;63(Pt 3):276-81. Epub 2007 Feb 21. |
| Groups | Approved; Investigational |
| Direct Classification | |
| SMILES | [Zn++].CC([O-])=O.CC([O-])=O |
| Pathways | |
| PharmGKB | |
| ChEMBL | CHEMBL1200928 |
