| VIS ID | Virus | Ensembl ID | Gene Type | Target Gene | Oncogene | Tumor Suppressor Gene | NCBI ID | Uniprot ID |
|---|---|---|---|---|---|---|---|---|
| TVIS20016345 | HPV | ENSG00000262406.3 | protein_coding | MMP12 | No | No | 4321 | P39900 |
Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | MMP12 |
|---|---|
| DrugBank ID | DB07446 |
| Drug Name | N-(biphenyl-4-ylsulfonyl)-D-leucine |
| Target ID | BE0001198 |
| UniProt ID | P39900 |
| Regulation Type | |
| PubMed IDs | 10592235 |
| Citations | Berman HM, Westbrook J, Feng Z, Gilliland G, Bhat TN, Weissig H, Shindyalov IN, Bourne PE: The Protein Data Bank. Nucleic Acids Res. 2000 Jan 1;28(1):235-42. |
| Groups | Experimental |
| Direct Classification | Leucine and derivatives |
| SMILES | [H][C@](CC(C)C)(NS(=O)(=O)C1=CC=C(C=C1)C1=CC=CC=C1)C(O)=O |
| Pathways | |
| PharmGKB | |
| ChEMBL |