| VIS ID | Virus | Ensembl ID | Gene Type | Target Gene | Oncogene | Tumor Suppressor Gene | NCBI ID | Uniprot ID |
|---|---|---|---|---|---|---|---|---|
| TVIS44033195 | HTLV-1 | ENSG00000180772.8 | protein_coding | AGTR2 | No | No | 186 | P50052 |
Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | AGTR2 |
|---|---|
| DrugBank ID | DB01349 |
| Drug Name | Tasosartan |
| Target ID | BE0003426 |
| UniProt ID | P50052 |
| Regulation Type | antagonist |
| PubMed IDs | 11683476 |
| Citations | Unger T: Pharmacology of AT1-receptor blockers. Blood Press Suppl. 2001;(3):5-10. |
| Groups | Experimental |
| Direct Classification | Biphenyls and derivatives |
| SMILES | CC1=NC(C)=C2CCC(=O)N(CC3=CC=C(C=C3)C3=CC=CC=C3C3=NNN=N3)C2=N1 |
| Pathways | |
| PharmGKB | PA164769057 |
| ChEMBL | CHEMBL432162 |
