| VIS ID | Virus | Ensembl ID | Gene Type | Target Gene | Oncogene | Tumor Suppressor Gene | NCBI ID | Uniprot ID |
|---|---|---|---|---|---|---|---|---|
| TVIS10053831 | HBV | ENSG00000166126.11 | protein_coding | AMN | No | No | 81693 | B3KP64 Q9BXJ7 |
Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | AMN |
|---|---|
| DrugBank ID | DB00200 |
| Drug Name | Hydroxocobalamin |
| Target ID | BE0000340 |
| UniProt ID | Q9BXJ7 |
| Regulation Type | other |
| PubMed IDs | 17139284; 17016423; 14585166 |
| Citations | Overington JP, Al-Lazikani B, Hopkins AL: How many drug targets are there? Nat Rev Drug Discov. 2006 Dec;5(12):993-6.@@Imming P, Sinning C, Meyer A: Drugs, their targets and the nature and number of drug targets. Nat Rev Drug Discov. 2006 Oct;5(10):821-34.@@Seetharam B, Yammani RR: Cobalamin transport proteins and their cell-surface receptors. Expert Rev Mol Med. 2003 Jun 13;5(18):1-18. |
| Groups | Approved |
| Direct Classification | Cobalamin derivatives |
| SMILES | [N+]1=2[Co-3]345([N+]6=C7[C@H]([C@@](CC(=O)N)(C)[C@@]6([C@@]6(N3C(=C(C)C3=[N+]4C(C(C)(C)[C@@H]3CCC(=O)N)=CC3=[N+]5C(=C7C)[C@@](CC(=O)N)([C@@H]3CCC(=O)N)C)[C@@](C)([C@H]6CC(=O)N)CCC(NC[C@@H](C)OP(=O)(O[C@@H]3[C@H](O[C@H](N(C4=CC(=C(C=C14)C)C)C=2)[C@@H]3O)CO)[O-])=O)[H])C)CCC(=O)N)O[H] |
| Pathways | |
| PharmGKB | PA164768689 |
| ChEMBL | CHEMBL2103737 |
