| VIS ID | Virus | Ensembl ID | Gene Type | Target Gene | Oncogene | Tumor Suppressor Gene | NCBI ID | Uniprot ID |
|---|---|---|---|---|---|---|---|---|
| TVIS10017611 | HBV | ENSG00000103152.12 | protein_coding | MPG | No | No | 4350 | P29372 Q1W6H1 |
Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | MPG |
|---|---|
| DrugBank ID | DB00515 |
| Drug Name | Cisplatin |
| Target ID | BE0008954 |
| UniProt ID | P29372 |
| Regulation Type | |
| PubMed IDs | 10891085 |
| Citations | Kartalou M, Samson LD, Essigmann JM: Cisplatin adducts inhibit 1,N(6)-ethenoadenine repair by interacting with the human 3-methyladenine DNA glycosylase. Biochemistry. 2000 Jul 11;39(27):8032-8. |
| Groups | Approved |
| Direct Classification | Transition metal chlorides |
| SMILES | [H][N]([H])([H])[Pt](Cl)(Cl)[N]([H])([H])[H] |
| Pathways | |
| PharmGKB | PA449014 |
| ChEMBL | CHEMBL11359 |
