| VIS ID | Virus | Ensembl ID | Gene Type | Target Gene | Oncogene | Tumor Suppressor Gene | NCBI ID | Uniprot ID |
|---|---|---|---|---|---|---|---|---|
| TVIS20040550 | HPV | ENSG00000175745.15 | protein_coding | NR2F1 | No | No | 7025 | P10589 |
Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | NR2F1 |
|---|---|
| DrugBank ID | DB06732 |
| Drug Name | beta-Naphthoflavone |
| Target ID | BE0008953 |
| UniProt ID | P10589 |
| Regulation Type | |
| PubMed IDs | 10620335 |
| Citations | Klinge CM, Kaur K, Swanson HI: The aryl hydrocarbon receptor interacts with estrogen receptor alpha and orphan receptors COUP-TFI and ERRalpha1. Arch Biochem Biophys. 2000 Jan 1;373(1):163-74. |
| Groups | Experimental |
| Direct Classification | Flavones |
| SMILES | O=C1C=C(OC2=C1C1=CC=CC=C1C=C2)C1=CC=CC=C1 |
| Pathways | |
| PharmGKB | |
| ChEMBL | CHEMBL26260 |
