| VIS ID | Virus | Ensembl ID | Gene Type | Target Gene | Oncogene | Tumor Suppressor Gene | NCBI ID | Uniprot ID |
|---|---|---|---|---|---|---|---|---|
| TVIS30079096 | HIV | ENSG00000180739.15 | protein_coding | S1PR5 | No | No | 53637 | Q9H228 |
| TVIS20020750 | HPV | ENSG00000180739.15 | protein_coding | S1PR5 | No | No | 53637 | Q9H228 |
Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | S1PR5 |
|---|---|
| DrugBank ID | DB08868 |
| Drug Name | Fingolimod |
| Target ID | BE0002432 |
| UniProt ID | Q9H228 |
| Regulation Type | modulator |
| PubMed IDs | 23579459; 23579456 |
| Citations | Zu Heringdorf DM, Ihlefeld K, Pfeilschifter J: Pharmacology of the sphingosine-1-phosphate signalling system. Handb Exp Pharmacol. 2013;(215):239-53. doi: 10.1007/978-3-7091-1368-4_13.@@Bhabak KP, Arenz C: Novel drugs targeting sphingolipid metabolism. Handb Exp Pharmacol. 2013;(215):187-96. doi: 10.1007/978-3-7091-1368-4_10. |
| Groups | Approved; Investigational |
| Direct Classification | Aralkylamines |
| SMILES | CCCCCCCCC1=CC=C(CCC(N)(CO)CO)C=C1 |
| Pathways | |
| PharmGKB | |
| ChEMBL | CHEMBL314854 |
