| VIS ID | Virus | Ensembl ID | Gene Type | Target Gene | Oncogene | Tumor Suppressor Gene | NCBI ID | Uniprot ID |
|---|---|---|---|---|---|---|---|---|
| TVIS10012710 | HBV | ENSG00000163581.14 | protein_coding | SLC2A2 | No | No | 6514 | P11168 Q6PAU8 |
Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | SLC2A2 |
|---|---|
| DrugBank ID | DB00428 |
| Drug Name | Streptozocin |
| Target ID | BE0001045 |
| UniProt ID | P11168 |
| Regulation Type | ligand |
| PubMed IDs | 9421374; 7926307 |
| Citations | Wang Z, Gleichmann H: GLUT2 in pancreatic islets: crucial target molecule in diabetes induced with multiple low doses of streptozotocin in mice. Diabetes. 1998 Jan;47(1):50-6.@@Schnedl WJ, Ferber S, Johnson JH, Newgard CB: STZ transport and cytotoxicity. Specific enhancement in GLUT2-expressing cells. Diabetes. 1994 Nov;43(11):1326-33. |
| Groups | Approved; Investigational |
| Direct Classification | Hexoses |
| SMILES | CN(N=O)C(=O)N[C@H]1[C@@H](O)O[C@H](CO)[C@@H](O)[C@@H]1O |
| Pathways | |
| PharmGKB | PA451514 |
| ChEMBL | CHEMBL1603 |
