| VIS ID | Virus | Ensembl ID | Gene Type | Target Gene | Oncogene | Tumor Suppressor Gene | NCBI ID | Uniprot ID |
|---|---|---|---|---|---|---|---|---|
| TVIS44050523 | HTLV-1 | ENSG00000232810.5 | protein_coding | TNF | No | No | 7124 | P01375 Q5STB3 |
Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | TNF |
|---|---|
| DrugBank ID | DB04297 |
| Drug Name | Trichostatin A |
| Target ID | BE0000704 |
| UniProt ID | P01375 |
| Regulation Type | downregulator |
| PubMed IDs | 19083427 |
| Citations | Usami M, Kishimoto K, Ohata A, Miyoshi M, Aoyama M, Fueda Y, Kotani J: Butyrate and trichostatin A attenuate nuclear factor kappaB activation and tumor necrosis factor alpha secretion and increase prostaglandin E2 secretion in human peripheral blood mononuclear cells. Nutr Res. 2008 May;28(5):321-8. doi: 10.1016/j.nutres.2008.02.012. |
| Groups | Experimental |
| Direct Classification | Alkyl-phenylketones |
| SMILES | C[C@H](C=C(/C)C=CC(=O)NO)C(=O)C1=CC=C(C=C1)N(C)C |
| Pathways | |
| PharmGKB | |
| ChEMBL | CHEMBL99 |