| VIS ID | Virus | Ensembl ID | Gene Type | Target Gene | Oncogene | Tumor Suppressor Gene | NCBI ID | Uniprot ID |
|---|---|---|---|---|---|---|---|---|
| TVIS44050523 | HTLV-1 | ENSG00000232810.5 | protein_coding | TNF | No | No | 7124 | P01375 Q5STB3 |
Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | TNF |
|---|---|
| DrugBank ID | DB01411 |
| Drug Name | Pranlukast |
| Target ID | BE0000704 |
| UniProt ID | P01375 |
| Regulation Type | other/unknown |
| PubMed IDs | 12801315; 12801316; 17430359 |
| Citations | Tomari S, Matsuse H, Machida I, Kondo Y, Kawano T, Obase Y, Fukushima C, Shimoda T, Kohno S: Pranlukast, a cysteinyl leukotriene receptor 1 antagonist, attenuates allergen-specific tumour necrosis factor alpha production and nuclear factor kappa B nuclear translocation in peripheral blood monocytes from atopic asthmatics. Clin Exp Allergy. 2003 Jun;33(6):795-801.@@Ichiyama T, Hasegawa S, Umeda M, Terai K, Matsubara T, Furukawa S: Pranlukast inhibits NF-kappa B activation in human monocytes/macrophages and T cells. Clin Exp Allergy. 2003 Jun;33(6):802-7.@@Ichiyama T, Kajimoto M, Hasegawa M, Hashimoto K, Matsubara T, Furukawa S: Cysteinyl leukotrienes enhance tumour necrosis factor-alpha-induced matrix metalloproteinase-9 in human monocytes/macrophages. Clin Exp Allergy. 2007 Apr;37(4):608-14. |
| Groups | Investigational |
| Direct Classification | Chromones |
| SMILES | O=C(NC1=C2OC(=CC(=O)C2=CC=C1)C1=NNN=N1)C1=CC=C(OCCCCC2=CC=CC=C2)C=C1 |
| Pathways | |
| PharmGKB | PA134698661 |
| ChEMBL | CHEMBL21333 |