| VIS ID | Virus | Ensembl ID | Gene Type | Target Gene | Oncogene | Tumor Suppressor Gene | NCBI ID | Uniprot ID |
|---|---|---|---|---|---|---|---|---|
| TVIS10038403 | HBV | ENSG00000187094.12 | protein_coding | CCK | No | No | 885 | P06307 Q6FG82 |
Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | CCK |
|---|---|
| DrugBank ID | DB13729 |
| Drug Name | Camostat |
| Target ID | BE0009923 |
| UniProt ID | P06307 |
| Regulation Type | inhibitor |
| PubMed IDs | 3562444 |
| Citations | Goke B, Printz H, Koop I, Rausch U, Richter G, Arnold R, Adler G: Endogenous CCK release and pancreatic growth in rats after feeding a proteinase inhibitor (camostate). Pancreas. 1986;1(6):509-15. doi: 10.1097/00006676-198611000-00008. |
| Groups | Experimental |
| Direct Classification | Depsides and depsidones |
| SMILES | CN(C)C(=O)COC(=O)CC1=CC=C(OC(=O)C2=CC=C(NC(N)=N)C=C2)C=C1 |
| Pathways | |
| PharmGKB | |
| ChEMBL | CHEMBL590799 |
