Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | CACNA1C |
|---|---|
| DrugBank ID | DB00825 |
| Drug Name | Levomenthol |
| Target ID | BE0008715 |
| UniProt ID | O00555 |
| Regulation Type | antagonist |
| PubMed IDs | 16121523; 2856502 |
| Citations | Grigoleit HG, Grigoleit P: Pharmacology and preclinical pharmacokinetics of peppermint oil. Phytomedicine. 2005 Aug;12(8):612-6. doi: 10.1016/j.phymed.2004.10.007.@@Hawthorn M, Ferrante J, Luchowski E, Rutledge A, Wei XY, Triggle DJ: The actions of peppermint oil and menthol on calcium channel dependent processes in intestinal, neuronal and cardiac preparations. Aliment Pharmacol Ther. 1988 Apr;2(2):101-18. |
| Groups | Approved |
| Direct Classification | Menthane monoterpenoids |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)C[C@H]1O |
| Pathways | |
| PharmGKB | PA164776605 |
| ChEMBL | CHEMBL470670 |
