Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | CACNA1C |
|---|---|
| DrugBank ID | DB04855 |
| Drug Name | Dronedarone |
| Target ID | BE0000430 |
| UniProt ID | Q13936 |
| Regulation Type | inhibitor |
| PubMed IDs | 23997577 |
| Citations | Heijman J, Heusch G, Dobrev D: Pleiotropic effects of antiarrhythmic agents: dronedarone in the treatment of atrial fibrillation. Clin Med Insights Cardiol. 2013 Aug 11;7:127-40. doi: 10.4137/CMC.S8445. eCollection 2013. |
| Groups | Approved |
| Direct Classification | Aryl-phenylketones |
| SMILES | CCCCN(CCCC)CCCOC1=CC=C(C=C1)C(=O)C1=C(CCCC)OC2=C1C=C(NS(C)(=O)=O)C=C2 |
| Pathways | |
| PharmGKB | PA153619853 |
| ChEMBL | CHEMBL184412 |
