| VIS ID | Virus | Ensembl ID | Gene Type | Target Gene | Oncogene | Tumor Suppressor Gene | NCBI ID | Uniprot ID |
|---|---|---|---|---|---|---|---|---|
| TVIS30082247 | HIV | ENSG00000104267.10 | protein_coding | CA2 | No | No | 760 | P00918 |
Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | CA2 |
|---|---|
| DrugBank ID | DB01144 |
| Drug Name | Diclofenamide |
| Target ID | BE0000322 |
| UniProt ID | P00918 |
| Regulation Type | inhibitor |
| PubMed IDs | 18336310 |
| Citations | Mincione F, Scozzafava A, Supuran CT: The development of topically acting carbonic anhydrase inhibitors as antiglaucoma agents. Curr Pharm Des. 2008;14(7):649-54. |
| Groups | Approved; Investigational |
| Direct Classification | Benzenesulfonamides |
| SMILES | NS(=O)(=O)C1=CC(=C(Cl)C(Cl)=C1)S(N)(=O)=O |
| Pathways | |
| PharmGKB | PA164745512 |
| ChEMBL | CHEMBL17 |