| VIS ID | Virus | Ensembl ID | Gene Type | Target Gene | Oncogene | Tumor Suppressor Gene | NCBI ID | Uniprot ID |
|---|---|---|---|---|---|---|---|---|
| TVIS30082247 | HIV | ENSG00000104267.10 | protein_coding | CA2 | No | No | 760 | P00918 |
Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | CA2 |
|---|---|
| DrugBank ID | DB00562 |
| Drug Name | Benzthiazide |
| Target ID | BE0000322 |
| UniProt ID | P00918 |
| Regulation Type | inhibitor |
| PubMed IDs | 17139284; 17016423; 11752352 |
| Citations | Overington JP, Al-Lazikani B, Hopkins AL: How many drug targets are there? Nat Rev Drug Discov. 2006 Dec;5(12):993-6.@@Imming P, Sinning C, Meyer A: Drugs, their targets and the nature and number of drug targets. Nat Rev Drug Discov. 2006 Oct;5(10):821-34.@@Chen X, Ji ZL, Chen YZ: TTD: Therapeutic Target Database. Nucleic Acids Res. 2002 Jan 1;30(1):412-5. |
| Groups | Approved |
| Direct Classification | 1,2,4-benzothiadiazine-1,1-dioxides |
| SMILES | NS(=O)(=O)C1=CC2=C(C=C1Cl)N=C(CSCC1=CC=CC=C1)NS2(=O)=O |
| Pathways | |
| PharmGKB | PA164776841 |
| ChEMBL | CHEMBL1201039 |
