| VIS ID | Virus | Ensembl ID | Gene Type | Target Gene | Oncogene | Tumor Suppressor Gene | NCBI ID | Uniprot ID |
|---|---|---|---|---|---|---|---|---|
| TVIS10028823 | HBV | ENSG00000138413.14 | protein_coding | IDH1 | Yes | No | 3417 | O75874 |
| TVIS10024841 | HBV | ENSG00000138413.14 | protein_coding | IDH1 | Yes | No | 3417 | O75874 |
| TVIS30003227 | HIV | ENSG00000138413.14 | protein_coding | IDH1 | Yes | No | 3417 | O75874 |
| TVIS30052261 | HIV | ENSG00000138413.14 | protein_coding | IDH1 | Yes | No | 3417 | O75874 |
Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | IDH1 |
|---|---|
| DrugBank ID | DB03461 |
| Drug Name | Nicotinamide adenine dinucleotide phosphate |
| Target ID | BE0001251 |
| UniProt ID | O75874 |
| Regulation Type | |
| PubMed IDs | 17139284; 17016423 |
| Citations | Overington JP, Al-Lazikani B, Hopkins AL: How many drug targets are there? Nat Rev Drug Discov. 2006 Dec;5(12):993-6.@@Imming P, Sinning C, Meyer A: Drugs, their targets and the nature and number of drug targets. Nat Rev Drug Discov. 2006 Oct;5(10):821-34. |
| Groups | Experimental |
| Direct Classification | (5'->5')-dinucleotides |
| SMILES | NC(=O)C1=CC=C[N+](=C1)[C@@H]1O[C@H](COP([O-])(=O)OP(O)(=O)OC[C@H]2O[C@H]([C@H](OP(O)(O)=O)[C@@H]2O)N2C=NC3=C2N=CN=C3N)[C@@H](O)[C@H]1O |
| Pathways | |
| PharmGKB | |
| ChEMBL | CHEMBL295069 |