| VIS ID | Virus | Ensembl ID | Gene Type | Target Gene | Oncogene | Tumor Suppressor Gene | NCBI ID | Uniprot ID |
|---|---|---|---|---|---|---|---|---|
| TVIS44047544 | HTLV-1 | ENSG00000103222.20 | protein_coding | ABCC1 | No | No | 4363 | P33527 |
Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | ABCC1 |
|---|---|
| DrugBank ID | DB04851 |
| Drug Name | Biricodar |
| Target ID | BE0000785 |
| UniProt ID | P33527 |
| Regulation Type | |
| PubMed IDs | 15014037 |
| Citations | Minderman H, O'Loughlin KL, Pendyala L, Baer MR: VX-710 (biricodar) increases drug retention and enhances chemosensitivity in resistant cells overexpressing P-glycoprotein, multidrug resistance protein, and breast cancer resistance protein. Clin Cancer Res. 2004 Mar 1;10(5):1826-34. |
| Groups | Investigational |
| Direct Classification | |
| SMILES | COC1=CC(=CC(OC)=C1OC)C(=O)C(=O)N1CCCC[C@H]1C(=O)OC(CCCC1=CN=CC=C1)CCCC1=CN=CC=C1 |
| Pathways | |
| PharmGKB | PA164924560 |
| ChEMBL | CHEMBL350775 |
