| VIS ID | Virus | Ensembl ID | Gene Type | Target Gene | Oncogene | Tumor Suppressor Gene | NCBI ID | Uniprot ID |
|---|---|---|---|---|---|---|---|---|
| TVIS44047544 | HTLV-1 | ENSG00000103222.20 | protein_coding | ABCC1 | No | No | 4363 | P33527 |
Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | ABCC1 |
|---|---|
| DrugBank ID | DB08855 |
| Drug Name | Leukotriene C4 |
| Target ID | BE0000785 |
| UniProt ID | P33527 |
| Regulation Type | |
| PubMed IDs | 15628876 |
| Citations | Karwatsky J, Leimanis M, Cai J, Gros P, Georges E: The leucotriene C4 binding sites in multidrug resistance protein 1 (ABCC1) include the first membrane multiple spanning domain. Biochemistry. 2005 Jan 11;44(1):340-51. |
| Groups | Experimental; Investigational |
| Direct Classification | Oligopeptides |
| SMILES | CCCCCC=C/CC=C/C=C/C=C/[C@@H](SC[C@H](NC(=O)CC[C@H](N)C(O)=O)C(=O)NCC(O)=O)[C@@H](O)CCCC(O)=O |
| Pathways | |
| PharmGKB | |
| ChEMBL | CHEMBL451509 |