| VIS ID | Virus | Ensembl ID | Gene Type | Target Gene | Oncogene | Tumor Suppressor Gene | NCBI ID | Uniprot ID |
|---|---|---|---|---|---|---|---|---|
| TVIS44047544 | HTLV-1 | ENSG00000103222.20 | protein_coding | ABCC1 | No | No | 4363 | P33527 |
Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | ABCC1 |
|---|---|
| DrugBank ID | DB06176 |
| Drug Name | Romidepsin |
| Target ID | BE0000785 |
| UniProt ID | P33527 |
| Regulation Type | |
| PubMed IDs | 15634944 |
| Citations | Xiao JJ, Foraker AB, Swaan PW, Liu S, Huang Y, Dai Z, Chen J, Sadee W, Byrd J, Marcucci G, Chan KK: Efflux of depsipeptide FK228 (FR901228, NSC-630176) is mediated by P-glycoprotein and multidrug resistance-associated protein 1. J Pharmacol Exp Ther. 2005 Apr;313(1):268-76. Epub 2005 Jan 5. |
| Groups | Approved; Investigational |
| Direct Classification | |
| SMILES | CC=C1/NC(=O)[C@H]2CSSCCC=C[C@H](CC(=O)N[C@H](C(C)C)C(=O)N2)OC(=O)[C@@H](NC1=O)C(C)C |
| Pathways | |
| PharmGKB | PA166161306 |
| ChEMBL | CHEMBL343448 |