| VIS ID | Virus | Ensembl ID | Gene Type | Target Gene | Oncogene | Tumor Suppressor Gene | NCBI ID | Uniprot ID |
|---|---|---|---|---|---|---|---|---|
| TVIS10000115 | HBV | ENSG00000036828.17 | protein_coding | CASR | Yes | Yes | 846 | P41180 |
| TVIS10000116 | HBV | ENSG00000036828.17 | protein_coding | CASR | Yes | Yes | 846 | P41180 |
| TVIS10014155 | HBV | ENSG00000036828.17 | protein_coding | CASR | Yes | Yes | 846 | P41180 |
| TVIS20036567 | HPV | ENSG00000036828.17 | protein_coding | CASR | Yes | Yes | 846 | P41180 |
| TVIS20042433 | HPV | ENSG00000036828.17 | protein_coding | CASR | Yes | Yes | 846 | P41180 |
Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | CASR |
|---|---|
| DrugBank ID | DB05255 |
| Drug Name | Ronacaleret |
| Target ID | BE0000509 |
| UniProt ID | P41180 |
| Regulation Type | antagonist |
| PubMed IDs | 21593114 |
| Citations | Fitzpatrick LA, Dabrowski CE, Cicconetti G, Gordon DN, Papapoulos S, Bone HG 3rd, Bilezikian JP: The effects of ronacaleret, a calcium-sensing receptor antagonist, on bone mineral density and biochemical markers of bone turnover in postmenopausal women with low bone mineral density. J Clin Endocrinol Metab. 2011 Aug;96(8):2441-9. doi: 10.1210/jc.2010-2855. Epub 2011 May 18. |
| Groups | Investigational |
| Direct Classification | Phenylpropanoic acids |
| SMILES | CC(C)(CC1CC2=C(C1)C=CC=C2)NC[C@@H](O)COC1=CC(CCC(O)=O)=CC(F)=C1F |
| Pathways | |
| PharmGKB | |
| ChEMBL | CHEMBL1198855 |
