| VIS ID | Virus | Ensembl ID | Gene Type | Target Gene | Oncogene | Tumor Suppressor Gene | NCBI ID | Uniprot ID |
|---|---|---|---|---|---|---|---|---|
| TVIS10000115 | HBV | ENSG00000036828.17 | protein_coding | CASR | Yes | Yes | 846 | P41180 |
| TVIS10000116 | HBV | ENSG00000036828.17 | protein_coding | CASR | Yes | Yes | 846 | P41180 |
| TVIS10014155 | HBV | ENSG00000036828.17 | protein_coding | CASR | Yes | Yes | 846 | P41180 |
| TVIS20036567 | HPV | ENSG00000036828.17 | protein_coding | CASR | Yes | Yes | 846 | P41180 |
| TVIS20042433 | HPV | ENSG00000036828.17 | protein_coding | CASR | Yes | Yes | 846 | P41180 |
Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | CASR |
|---|---|
| DrugBank ID | DB12865 |
| Drug Name | Etelcalcetide |
| Target ID | BE0000509 |
| UniProt ID | P41180 |
| Regulation Type | agonist |
| PubMed IDs | 24235081 |
| Citations | Martin KJ, Bell G, Pickthorn K, Huang S, Vick A, Hodsman P, Peacock M: Velcalcetide (AMG 416), a novel peptide agonist of the calcium-sensing receptor, reduces serum parathyroid hormone and FGF23 levels in healthy male subjects. Nephrol Dial Transplant. 2014 Feb;29(2):385-92. doi: 10.1093/ndt/gft417. Epub 2013 Nov 13. |
| Groups | Approved; Investigational |
| Direct Classification | Oligopeptides |
| SMILES | C[C@@H](NC(=O)[C@@H](CCCNC(N)=N)NC(=O)[C@@H](CCCNC(N)=N)NC(=O)[C@@H](CCCNC(N)=N)NC(=O)[C@@H](C)NC(=O)[C@@H](CSSC[C@H](N)C(O)=O)NC(C)=O)C(=O)N[C@H](CCCNC(N)=N)C(N)=O |
| Pathways | |
| PharmGKB | |
| ChEMBL | CHEMBL3545184 |