| VIS ID | Virus | Ensembl ID | Gene Type | Target Gene | Oncogene | Tumor Suppressor Gene | NCBI ID | Uniprot ID |
|---|---|---|---|---|---|---|---|---|
| TVIS10000115 | HBV | ENSG00000036828.17 | protein_coding | CASR | Yes | Yes | 846 | P41180 |
| TVIS10000116 | HBV | ENSG00000036828.17 | protein_coding | CASR | Yes | Yes | 846 | P41180 |
| TVIS10014155 | HBV | ENSG00000036828.17 | protein_coding | CASR | Yes | Yes | 846 | P41180 |
| TVIS20036567 | HPV | ENSG00000036828.17 | protein_coding | CASR | Yes | Yes | 846 | P41180 |
| TVIS20042433 | HPV | ENSG00000036828.17 | protein_coding | CASR | Yes | Yes | 846 | P41180 |
Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | CASR |
|---|---|
| DrugBank ID | DB05695 |
| Drug Name | NPS-2143 |
| Target ID | BE0000509 |
| UniProt ID | P41180 |
| Regulation Type | |
| PubMed IDs | 17932932 |
| Citations | Bu L, Michino M, Wolf RM, Brooks CL 3rd: Improved model building and assessment of the Calcium-sensing receptor transmembrane domain. Proteins. 2008 Apr;71(1):215-26. |
| Groups | Investigational |
| Direct Classification | Naphthalenes |
| SMILES | CC(C)(CC1=CC=C2C=CC=CC2=C1)NC[C@@H](O)COC1=CC=CC(Cl)=C1C#N |
| Pathways | |
| PharmGKB | |
| ChEMBL | CHEMBL180672 |
