| VIS ID | Virus | Ensembl ID | Gene Type | Target Gene | Oncogene | Tumor Suppressor Gene | NCBI ID | Uniprot ID |
|---|---|---|---|---|---|---|---|---|
| TVIS44045368 | HTLV-1 | ENSG00000112033.14 | protein_coding | PPARD | No | No | 5467 | Q03181 |
Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | PPARD |
|---|---|
| DrugBank ID | DB01393 |
| Drug Name | Bezafibrate |
| Target ID | BE0001007 |
| UniProt ID | Q03181 |
| Regulation Type | agonist |
| PubMed IDs | 16168052 |
| Citations | Tenenbaum A, Motro M, Fisman EZ: Dual and pan-peroxisome proliferator-activated receptors (PPAR) co-agonism: the bezafibrate lessons. Cardiovasc Diabetol. 2005 Sep 16;4:14. |
| Groups | Approved; Investigational |
| Direct Classification | Phenoxyacetic acid derivatives |
| SMILES | CC(C)(OC1=CC=C(CCNC(=O)C2=CC=C(Cl)C=C2)C=C1)C(O)=O |
| Pathways | |
| PharmGKB | PA162364313 |
| ChEMBL | CHEMBL264374 |
