| VIS ID | Virus | Ensembl ID | Gene Type | Target Gene | Oncogene | Tumor Suppressor Gene | NCBI ID | Uniprot ID |
|---|---|---|---|---|---|---|---|---|
| TVIS30065498 | HIV | ENSG00000118432.13 | protein_coding | CNR1 | No | No | 1268 | P21554 S5TLS4 V5KA96 |
Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | CNR1 |
|---|---|
| DrugBank ID | DB11755 |
| Drug Name | Tetrahydrocannabivarin |
| Target ID | BE0000061 |
| UniProt ID | P21554 |
| Regulation Type | antagonist |
| PubMed IDs | 28120232 |
| Citations | Morales P, Hurst DP, Reggio PH: Molecular Targets of the Phytocannabinoids: A Complex Picture. Prog Chem Org Nat Prod. 2017;103:103-131. doi: 10.1007/978-3-319-45541-9_4. |
| Groups | Investigational |
| Direct Classification | 2,2-dimethyl-1-benzopyrans |
| SMILES | CCCC1=CC(O)=C2[C@@H]3C=C(C)CC[C@H]3C(C)(C)OC2=C1 |
| Pathways | |
| PharmGKB | |
| ChEMBL | CHEMBL2387541 |