| VIS ID | Virus | Ensembl ID | Gene Type | Target Gene | Oncogene | Tumor Suppressor Gene | NCBI ID | Uniprot ID |
|---|---|---|---|---|---|---|---|---|
| TVIS30065498 | HIV | ENSG00000118432.13 | protein_coding | CNR1 | No | No | 1268 | P21554 S5TLS4 V5KA96 |
Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | CNR1 |
|---|---|
| DrugBank ID | DB06155 |
| Drug Name | Rimonabant |
| Target ID | BE0000061 |
| UniProt ID | P21554 |
| Regulation Type | antagonist |
| PubMed IDs | 8636122; 11752352 |
| Citations | Shire D, Calandra B, Delpech M, Dumont X, Kaghad M, Le Fur G, Caput D, Ferrara P: Structural features of the central cannabinoid CB1 receptor involved in the binding of the specific CB1 antagonist SR 141716A. J Biol Chem. 1996 Mar 22;271(12):6941-6.@@Chen X, Ji ZL, Chen YZ: TTD: Therapeutic Target Database. Nucleic Acids Res. 2002 Jan 1;30(1):412-5. |
| Groups | Approved; Investigational |
| Direct Classification | Phenylpyrazoles |
| SMILES | CC1=C(N(N=C1C(=O)NN1CCCCC1)C1=C(Cl)C=C(Cl)C=C1)C1=CC=C(Cl)C=C1 |
| Pathways | |
| PharmGKB | PA152407999 |
| ChEMBL | CHEMBL111 |
