| VIS ID | Virus | Ensembl ID | Gene Type | Target Gene | Oncogene | Tumor Suppressor Gene | NCBI ID | Uniprot ID |
|---|---|---|---|---|---|---|---|---|
| TVIS30075177 | HIV | ENSG00000196396.10 | protein_coding | PTPN1 | Yes | Yes | 5770 | A8K3M3 B4DSN5 P18031 |
| TVIS30053927 | HIV | ENSG00000196396.10 | protein_coding | PTPN1 | Yes | Yes | 5770 | A8K3M3 B4DSN5 P18031 |
| TVIS30053928 | HIV | ENSG00000196396.10 | protein_coding | PTPN1 | Yes | Yes | 5770 | A8K3M3 B4DSN5 P18031 |
| TVIS30053929 | HIV | ENSG00000196396.10 | protein_coding | PTPN1 | Yes | Yes | 5770 | A8K3M3 B4DSN5 P18031 |
| TVIS30053930 | HIV | ENSG00000196396.10 | protein_coding | PTPN1 | Yes | Yes | 5770 | A8K3M3 B4DSN5 P18031 |
| TVIS30053931 | HIV | ENSG00000196396.10 | protein_coding | PTPN1 | Yes | Yes | 5770 | A8K3M3 B4DSN5 P18031 |
| TVIS30053932 | HIV | ENSG00000196396.10 | protein_coding | PTPN1 | Yes | Yes | 5770 | A8K3M3 B4DSN5 P18031 |
| TVIS30053933 | HIV | ENSG00000196396.10 | protein_coding | PTPN1 | Yes | Yes | 5770 | A8K3M3 B4DSN5 P18031 |
| TVIS30053934 | HIV | ENSG00000196396.10 | protein_coding | PTPN1 | Yes | Yes | 5770 | A8K3M3 B4DSN5 P18031 |
| TVIS20018933 | HPV | ENSG00000196396.10 | protein_coding | PTPN1 | Yes | Yes | 5770 | A8K3M3 B4DSN5 P18031 |
Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | PTPN1 |
|---|---|
| DrugBank ID | DB07295 |
| Drug Name | 2-[(7-HYDROXY-NAPHTHALEN-1-YL)-OXALYL-AMINO]-BENZOIC ACID |
| Target ID | BE0000623 |
| UniProt ID | P18031 |
| Regulation Type | |
| PubMed IDs | 10592235 |
| Citations | Berman HM, Westbrook J, Feng Z, Gilliland G, Bhat TN, Weissig H, Shindyalov IN, Bourne PE: The Protein Data Bank. Nucleic Acids Res. 2000 Jan 1;28(1):235-42. |
| Groups | Experimental |
| Direct Classification | Acylaminobenzoic acid and derivatives |
| SMILES | OC(=O)C(=O)N(C1=CC=CC=C1C(O)=O)C1=CC=CC2=CC=C(O)C=C12 |
| Pathways | |
| PharmGKB | |
| ChEMBL | CHEMBL305785 |