Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | KCNMA1 |
|---|---|
| DrugBank ID | DB04209 |
| Drug Name | Dequalinium |
| Target ID | BE0000553 |
| UniProt ID | Q12791 |
| Regulation Type | inhibitor |
| PubMed IDs | 8100530 |
| Citations | Castle NA, Haylett DG, Morgan JM, Jenkinson DH: Dequalinium: a potent inhibitor of apamin-sensitive K+ channels in hepatocytes and of nicotinic responses in skeletal muscle. Eur J Pharmacol. 1993 May 19;236(2):201-7. |
| Groups | Approved; Investigational |
| Direct Classification | 4-aminoquinolines |
| SMILES | CC1=CC(N)=C2C=CC=CC2=[N+]1CCCCCCCCCC[N+]1=C(C)C=C(N)C2=C1C=CC=C2 |
| Pathways | |
| PharmGKB | |
| ChEMBL | CHEMBL333826 |
