Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | KCNMA1 |
|---|---|
| DrugBank ID | DB01054 |
| Drug Name | Nitrendipine |
| Target ID | BE0004906 |
| UniProt ID | Q9UGI6 |
| Regulation Type | inhibitor |
| PubMed IDs | 1733781 |
| Citations | Ellory JC, Kirk K, Culliford SJ, Nash GB, Stuart J: Nitrendipine is a potent inhibitor of the Ca(2+)-activated K+ channel of human erythrocytes. FEBS Lett. 1992 Jan 20;296(2):219-21. doi: 10.1016/0014-5793(92)80383-r. |
| Groups | Approved; Investigational |
| Direct Classification | Dihydropyridinecarboxylic acids and derivatives |
| SMILES | CCOC(=O)C1=C(C)NC(C)=C(C1C1=CC(=CC=C1)[N+]([O-])=O)C(=O)OC |
| Pathways | Nitrendipine Action Pathway |
| PharmGKB | PA146096020 |
| ChEMBL | CHEMBL475534 |
