Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | KCNMA1 |
|---|---|
| DrugBank ID | DB00774 |
| Drug Name | Hydroflumethiazide |
| Target ID | BE0000553 |
| UniProt ID | Q12791 |
| Regulation Type | inducer |
| PubMed IDs | 29188803 |
| Citations | Martin P, Moncada M, Kuntamallappanavar G, Dopico AM, Milesi V: Activation of human smooth muscle BK channels by hydrochlorothiazide requires cell integrity and the presence of BK beta1 subunit. Acta Pharmacol Sin. 2018 Mar;39(3):371-381. doi: 10.1038/aps.2017.133. Epub 2017 Nov 30. |
| Groups | Approved; Investigational; Withdrawn |
| Direct Classification | 1,2,4-benzothiadiazine-1,1-dioxides |
| SMILES | NS(=O)(=O)C1=CC2=C(NCNS2(=O)=O)C=C1C(F)(F)F |
| Pathways | Hydroflumethiazide Action Pathway |
| PharmGKB | PA164752557 |
| ChEMBL | CHEMBL1763 |
