| VIS ID | Virus | Ensembl ID | Gene Type | Target Gene | Oncogene | Tumor Suppressor Gene | NCBI ID | Uniprot ID |
|---|---|---|---|---|---|---|---|---|
| TVIS20005688 | HPV | ENSG00000159640.17 | protein_coding | ACE | No | No | 1636 | P12821 |
Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | ACE |
|---|---|
| DrugBank ID | DB03740 |
| Drug Name | N-acetyl-alpha-D-glucosamine |
| Target ID | BE0000221 |
| UniProt ID | P12821 |
| Regulation Type | |
| PubMed IDs | 17139284; 17016423 |
| Citations | Overington JP, Al-Lazikani B, Hopkins AL: How many drug targets are there? Nat Rev Drug Discov. 2006 Dec;5(12):993-6.@@Imming P, Sinning C, Meyer A: Drugs, their targets and the nature and number of drug targets. Nat Rev Drug Discov. 2006 Oct;5(10):821-34. |
| Groups | Experimental |
| Direct Classification | N-acyl-alpha-hexosamines |
| SMILES | CC(=O)N[C@H]1[C@@H](O)O[C@H](CO)[C@@H](O)[C@@H]1O |
| Pathways | |
| PharmGKB | |
| ChEMBL | CHEMBL1234669 |