| VIS ID | Virus | Ensembl ID | Gene Type | Target Gene | Oncogene | Tumor Suppressor Gene | NCBI ID | Uniprot ID |
|---|---|---|---|---|---|---|---|---|
| TVIS20005688 | HPV | ENSG00000159640.17 | protein_coding | ACE | No | No | 1636 | P12821 |
Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | ACE |
|---|---|
| DrugBank ID | DB13166 |
| Drug Name | Zofenopril |
| Target ID | BE0000221 |
| UniProt ID | P12821 |
| Regulation Type | inhibitor |
| PubMed IDs | 17355163 |
| Citations | Ambrosioni E: Defining the role of zofenopril in the management of hypertension and ischemic heart disorders. Am J Cardiovasc Drugs. 2007;7(1):17-24. |
| Groups | Approved |
| Direct Classification | Proline and derivatives |
| SMILES | C[C@H](CSC(=O)C1=CC=CC=C1)C(=O)N1C[C@H](C[C@H]1C(O)=O)SC1=CC=CC=C1 |
| Pathways | |
| PharmGKB | |
| ChEMBL | CHEMBL331378 |
