| VIS ID | Virus | Ensembl ID | Gene Type | Target Gene | Oncogene | Tumor Suppressor Gene | NCBI ID | Uniprot ID |
|---|---|---|---|---|---|---|---|---|
| TVIS30080752 | HIV | ENSG00000197122.13 | protein_coding | SRC | Yes | No | 6714 | P12931 |
| TVIS30081124 | HIV | ENSG00000197122.13 | protein_coding | SRC | Yes | No | 6714 | P12931 |
| TVIS30020612 | HIV | ENSG00000197122.13 | protein_coding | SRC | Yes | No | 6714 | P12931 |
Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | SRC |
|---|---|
| DrugBank ID | DB01866 |
| Drug Name | RU79256 |
| Target ID | BE0000838 |
| UniProt ID | P12931 |
| Regulation Type | |
| PubMed IDs | 10592235 |
| Citations | Berman HM, Westbrook J, Feng Z, Gilliland G, Bhat TN, Weissig H, Shindyalov IN, Bourne PE: The Protein Data Bank. Nucleic Acids Res. 2000 Jan 1;28(1):235-42. |
| Groups | Experimental |
| Direct Classification | Benzene and substituted derivatives |
| SMILES | [H][C@](C(O)=O)(C1=CC=CC=C1)S(O)(=O)=O |
| Pathways | |
| PharmGKB | |
| ChEMBL |
