| VIS ID | Virus | Ensembl ID | Gene Type | Target Gene | Oncogene | Tumor Suppressor Gene | NCBI ID | Uniprot ID |
|---|---|---|---|---|---|---|---|---|
| TVIS20030137 | HPV | ENSG00000103546.19 | protein_coding | SLC6A2 | No | No | 6530 | P23975 |
Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | SLC6A2 |
|---|---|
| DrugBank ID | DB04896 |
| Drug Name | Milnacipran |
| Target ID | BE0000486 |
| UniProt ID | P23975 |
| Regulation Type | inhibitor |
| PubMed IDs | 16869117; 3005901 |
| Citations | Leo RJ, Brooks VL: Clinical potential of milnacipran, a serotonin and norepinephrine reuptake inhibitor, in pain. Curr Opin Investig Drugs. 2006 Jul;7(7):637-42.@@Moret C, Charveron M, Finberg JP, Couzinier JP, Briley M: Biochemical profile of midalcipran (F 2207), 1-phenyl-1-diethyl-aminocarbonyl-2-aminomethyl-cyclopropane (Z) hydrochloride, a potential fourth generation antidepressant drug. Neuropharmacology. 1985 Dec;24(12):1211-9. |
| Groups | Approved; Investigational |
| Direct Classification | |
| SMILES | CCN(CC)C(=O)C1(CC1CN)C1=CC=CC=C1 |
| Pathways | |
| PharmGKB | PA164752812 |
| ChEMBL | CHEMBL259209 |
