| VIS ID | Virus | Ensembl ID | Gene Type | Target Gene | Oncogene | Tumor Suppressor Gene | NCBI ID | Uniprot ID |
|---|---|---|---|---|---|---|---|---|
| TVIS20008608 | HPV | ENSG00000167434.10 | protein_coding | CA4 | No | No | 762 | P22748 |
Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | CA4 |
|---|---|
| DrugBank ID | DB00869 |
| Drug Name | Dorzolamide |
| Target ID | BE0000535 |
| UniProt ID | P22748 |
| Regulation Type | inhibitor |
| PubMed IDs | 8875343 |
| Citations | Sugrue MF: The preclinical pharmacology of dorzolamide hydrochloride, a topical carbonic anhydrase inhibitor. J Ocul Pharmacol Ther. 1996 Fall;12(3):363-76. |
| Groups | Approved |
| Direct Classification | 2,3,5-trisubstituted thiophenes |
| SMILES | CCN[C@H]1C[C@H](C)S(=O)(=O)C2=C1C=C(S2)S(N)(=O)=O |
| Pathways | |
| PharmGKB | PA164748765 |
| ChEMBL | CHEMBL218490 |
