General information | Literature | Expression | Regulation | Variant | Interaction |
Basic Information |
|
---|---|
Gene ID | 7157 |
Name | TP53 |
Synonymous | BCC7|LFS1|P53|TRP53;tumor protein p53;TP53;tumor protein p53 |
Definition | antigen NY-CO-13|cellular tumor antigen p53|p53 tumor suppressor|phosphoprotein p53|transformation-related protein 53 |
Position | 17p13.1 |
Gene Type | protein-coding |
Gene Regulation: | ENCODE RegulomeDB Transcription Factors Post Transcriptional Modification From dbPTM Methylation Profile From DiseaseMeth database |
ENCODE RegulomeDB [Top] | |||
Link to UCSC genome |
Matched SNP location |
dbSNP ID |
Regulatory information |
chr17:7565097-7590856 | chr17:7570189-7570189 | rs9893249 | Single_Nucleotides|eQTL|SAT2, Motifs|PWM|TGIF1, Chromatin_Structure|DNase-seq|Werirb1 |
---|
Transcription Factors [Top] |
Regulation From TransFac database |
p53(h) --> Siah1(h) (activation) | p53(h) --/ PS1(m) (inhibition) | Ref-1(h) + Trx1(h){reC}2 + p53(h) <==> Ref-1(h):Trx1(h){reC}2:p53(h) (binding) | p53(h) + Ref-1(h) <==> p53(h):Ref-1(h) (binding) | brca1(h) + p53(h) <==> brca1(h):p53(h) (binding) | p53(h) --> CDKN1A(h) (DNA binding; transactivation) | p53(h) --> RB1(h) (DNA binding). | p53(h) --> BAX(h) (transactivation) | p53(h) --> bbc3(h) (DNA binding; transactivation). | p53(h) --> CASP1(h) (DNA binding; transactivation). | p53(h) --> Abcb1b(m) (DNA binding; transactivation). | p53(h) --> CKM(m) (DNA binding; transactivation). | p53(h) --> MDM2(h) (transactivation) | p53(h) --> GADD45A(h) (DNA binding; transactivation). | p53(h) --> Pmaip1(m) (DNA binding; transactivation). | p53(h) --> PERP(m) (DNA binding; transactivation). | p53(h) --> Ccng1(r) (DNA binding; transactivation). | p53(h) --> SFN(h) (transactivation) | p53(h) + mdm2(h) <==> p53(h):mdm2(h) (binding) | p53(h) + mdm2(x) <==> p53(h):mdm2(x) (binding) | p53(h) + p16INK4a-p14(h) <==> p53(h):p16INK4a-p14(h) (binding) | p53(h) + mdm2(h) + p16INK4a-p14(h) <==> p53(h):mdm2(h):p16INK4a-p14(h) (binding) | p53(h) + n ubiquitin(h) --E1(m),Ubc5A(h),mdm2(h)--> p53(h){ub(n)} (ubiquitination) | p53(h) --mdm2(h){ub}--> p53(h){ub(n)} (ubiquitination) | p53(h) + n ubiquitin(h) --mdm2(h)--> p53(h){ub(n)} (ubiquitination) | p53(h) + SIRT1(h) <==> p53(h):SIRT1(h) (binding) | p53(h) + acetyl-CoA --p300(h)--> p53(h){ace} + CoA (acetylation) | p53(h) + acetyl-CoA --p/CAF(h)--> p53(h){ace} + CoA (acetylation) | p300(h) + p53(h) + mdm2(h) <==> p300(h):p53(h):mdm2(h) (binding) | p53(h) + p300(h) <==> p53(h):p300(h) (binding) | p53(h) + ATP --p38(h){p}--> p53(h){p} + ADP (phosphorylation) | p53(h) + HDAC1(h) <==> p53(h):HDAC1(h) (binding) | p53(h) + hdac2(h) <==> p53(h):hdac2(h) (binding) | p53(h) + HDAC3(h) <==> p53(h):HDAC3(h) (binding) | p53(h) + ADA3(h) <==> p53(h):ADA3(h) (binding) | T-Ag(SV) + p53(h) <==> T-Ag(SV):p53(h) (binding) | p53(h) + 53BP1(h) <==> p53(h):53BP1(h) (binding) | p53(h) + JNK(h) <==> p53(h):JNK(h) (binding) | p53(h) + ATP --p38(m){p}--> p53(h){p} + ADP (phosphorylation) | p53(h) + ERK2(h) <==> p53(h):ERK2(h) (binding) | p53(h) + ATP --ERK2(r)--> p53(h){pT55} + ADP (phosphorylation) | p53(h) + ATP --cyclinB1(h):Cdk1(h)--> p53(h){pS315} + ADP (phosphorylation) | p53(h) + ATP --cyclinB1(h):Cdk2(h)--> p53(h){pS315} + ADP (phosphorylation) | p53(h) + ATP --cyclinA(h):Cdk1(h)--> p53(h){pS315} + ADP (phosphorylation) | p53(h) + ATP --cyclinA(h):Cdk2(h)--> p53(h){pS315} + ADP (phosphorylation) | p53(h) <==> (p53(h))4 (binding) | p53(h) + ATP --CKII-alpha(h):CKII-alpha2(h):(CKII-beta(h))2:SPT16(h):SSRP1(h)--> p53(h){pS392} + ADP (phosphorylation) | p53(h) + ATP --CKII-alpha2(h):CKII-beta(h):SPT16(h):SSRP1(h)--> p53(h){pS392} + ADP (phosphorylation) | p53(h) + tms1(fy) <==> p53(h):tms1(fy) (binding) | p53(h) + ATP --JNK2(h){p}--> p53(h){pT81} + ADP (phosphorylation) | p53(h) + PIAS1(h) <==> p53(h):PIAS1(h) (binding) | p53(h) + ATP --p38(h){p}--> p53(h){pS33} + ADP (phosphorylation) | p53(h) + CKII-beta(h) <==> p53(h):CKII-beta(h) (binding) | 2 ATP + p53(h) --DNA-PK(h)--> ADP + p53(h){pS15}{pS37} (phosphorylation) | p53(h) + ATP --ATR(h)--> p53(h){pS15} + ADP (phosphorylation) | p53(h) + ATP --JNK1alpha1(h){p}--> p53(h){pS20} + ADP (phosphorylation) | p53(h) + ATP --JNK2alpha-2(h){p}--> p53(h){pS20} + ADP (phosphorylation) | p53(h) + ATP --ERK1(h){p}--> p53(h){pS15} + ADP (phosphorylation) | p53(h) + ATP --ERK2(m){p}--> p53(h){pS15} + ADP (phosphorylation) | p53(h) + ATP --MAPKAPK2(h){p}--> p53(h){pS20} + ADP (phosphorylation) | p53(h) + ATP --ATM(h)--> p53(h){pS15} + ADP (phosphorylation) | p53(h) + ATP --ATM(h)--> p53(h){pS20} + ADP (phosphorylation) | p53(h) + ATP --Chk2(h)--> p53(h){pS20} + ADP (phosphorylation) | p53(h) + 14-3-3(h) <==> p53(h):14-3-3(h) (binding) | p53(h) + ATP --Chk2(h)--> p53(h){pS15} + ADP (phosphorylation) | p53(h) + ATP --Chk2(h)--> p53(h){pT18} + ADP (phosphorylation) | p53(h) + ATP --Chk2(h)--> p53(h){pS37} + ADP (phosphorylation) | p53(h) + ATP --Chk1(h)--> p53(h){pS15} + ADP (phosphorylation) | p53(h) + ATP --Chk1(h)--> p53(h){pS20} + ADP (phosphorylation) | p53(h) + ATP --Chk1(h)--> p53(h){pS37} + ADP (phosphorylation) | p53(h) + CKII-alpha(h) + CKII-beta(h) <==> p53(h):CKII-alpha(h):CKII-beta(h) (binding) | hipk2(h) + p53(h) <==> hipk2(h):p53(h) (binding) | PML-3(h) + p53(h) <==> PML-3(h):p53(h) (binding) | p53(h) + MTA1L1(h) <==> p53(h):MTA1L1(h) (binding) | p53(h) + plk3(h) <==> p53(h):plk3(h) (binding) | p53(h) + ATP --plk1(h)--> p53(h){p} + ADP (phosphorylation) | p53(h) + hipk2(m) <==> p53(h):hipk2(m) (binding) | ATM(h) + p53(h) <==> ATM(h):p53(h) (binding) | p38(h) + p53(h) <==> p38(h):p53(h) (binding) | p53(h) + ATP --TFIIH-CAK(h)--> p53(h){p} + ADP (phosphorylation) | TFIIH-CAK(h) + p53(h) <==> TFIIH-CAK(h):p53(h) (binding) | MAT1(h) + p53(h) <==> MAT1(h):p53(h) (binding) | p53(h) + ATP --TFIIH-CAK(h)--> p53(h){pS33} + ADP (phosphorylation) | cyclinH(h) + p53(h) <==> cyclinH(h):p53(h) (binding) | p53(h) + s100b(b) <==> p53(h):s100b(b) (binding) | Cdc14A(h) + p53(h) <==> Cdc14A(h):p53(h) (binding) | Cdc14B(h) + p53(h) <==> Cdc14B(h):p53(h) (binding) | p53(h) + ATP --CSN(h)--> p53(h){pT155} + ADP (phosphorylation) | CSN(h) + p53(h) <==> CSN(h):p53(h) (binding) | JAB1(h) + p53(h) <==> JAB1(h):p53(h) (binding) | brca1(r) + p53(h) <==> brca1(r):p53(h) (binding) | SMN(h) + p53(h) <==> SMN(h):p53(h) (binding) | HCV-core(HCV) + p53(h) <==> HCV-core(HCV):p53(h) (binding) | E2F-1(h) + p53(h) <==> E2F-1(h):p53(h) (binding) | E2F-2(h) + p53(h) <==> E2F-2(h):p53(h) (binding) | E2F-3(h) + p53(h) <==> E2F-3(h):p53(h) (binding) | p53(h) + Mdm4-L(m) <==> p53(h):Mdm4-L(m) (binding) | p53(h) + Mdm4-S(m) <==> p53(h):Mdm4-S(m) (binding) | DP-1(h) + p53(h) <==> DP-1(h):p53(h) (binding). | WT1(h) + p53(h) <==> WT1(h):p53(h) (binding). | TBP(h) + p53(h) <==> TBP(h):p53(h) (binding) | TAF(II)31(h) + p53(h) <==> TAF(II)31(h):p53(h) (binding) | p53(h) --> TP53(h) (DNA binding). | PKR(h) + p53(h) <==> PKR(h):p53(h) (binding) | HIF-1alpha(h) + p53(h) <==> HIF-1alpha(h):p53(h) (binding) | BRG1(h) + p53(h) <==> BRG1(h):p53(h) (binding) | BAF47(h) + p53(h) <==> BAF47(h):p53(h) (binding) | BAF47(h) + BAF155(h) + BRG1(h) + p53(h) <==> BAF47(h):BAF155(h):BRG1(h):p53(h) (binding) | p53(h) + p53(h) <==> p53(h):p53(h) (binding). | Zta(EBV) + p53(h) <==> Zta(EBV):p53(h) (binding). | TFIIH(h) + p53(h) <==> TFIIH(h):p53(h) (binding). | TBP(m) + p53(h) <==> TBP(m):p53(h) (binding). | p53(h) + Net(h) <==> p53(h):Net(h) (binding) | p53(h) + COP1(h) <==> p53(h):COP1(h) (binding) | p53(h) + LKB1(h) <==> p53(h):LKB1(h) (binding) | p53(h) + n ubiquitin(v.s.) --COP1(h)--> p53(h){ub(n)} (ubiquitination) | p53(h) + n ubiquitin(v.s.) --E1(rb),Ubc5A(h),COP1(h)--> p53(h){ub(n)} (ubiquitination) | p53(h) --> RFWD2(h) (DNA binding; transactivation). | Daxx(h) + p53(h) <==> p53(h):Daxx(h) (binding) | p53(h) + hipk2(ha) <==> p53(h):hipk2(ha) (binding) | p53(h) + sumo1(h) --> p53(h){sumo} (sumoylation) | p53(h) + Ubc9(h) <==> p53(h):Ubc9(h) (binding) | p53(h) + Mi2-alpha(h) <==> p53(h):Mi2-alpha(h) (binding) | p53(h) + hipk3(h) <==> p53(h):hipk3(h) (binding) | p53(h) + TDG(h) <==> p53(h):TDG(h) (binding) | p53(h) + Pin1(h) <==> p53(h):Pin1(h) (binding) | p53(h) + WT1 I -KTS(h) <==> p53(h):WT1 I -KTS(h) (binding) | p53(h) + Mdm4(h) <==> p53(h):Mdm4(h) (binding) | p53(h) + SRP1alpha(h) <==> p53(h):SRP1alpha(h) (binding) | p53(h) + ATP --Aurora-A(h){pT288}--> p53(h){pS315} + ADP (phosphorylation) | p53(h) + Aurora-A(h) <==> p53(h):Aurora-A(h) (binding) | CTF-2(h) + p53(h) <==> CTF-2(h):p53(h) (binding; interaction) | p53(h) + p/CAF(h) <==> p53(h):P/CAF(h) (binding; interaction) | GKLF-isoform1(h) + p53(h) <==> p53(h):GKLF-isoform1(h) (binding) | p53(h) --> DDIT4(h) (transactivation) | DeltaNp73alpha(m) + p53(h) <==> DeltaNp73alpha(m):p53(h) (binding; interaction) | p53(h) + DeltaNp73beta(m) <==> DeltaNp73beta(m):p53(h) (binding; interaction) | p53(h) --> RRM2B(h) (transactivation) | p53(h) + n ubiquitin(v.s.) --E1(v.s.),Ubc5(h),mdm2(h)--> p53(h){ub(n)} (ubiquitination) | p53(h) + n ubiquitin(v.s.) --E1(v.s.),Ubc5(h),E6(HPV5),E6AP(h)--> p53(h){ub(n)} (ubiquitination) | p53(h) --> TP73(h) (DNA binding; transactivation). | p53(h) --> TP63(h) (DNA binding; transactivation). | p53(h) + S-adenosylmethionine --Set9(h)--> p53(h){metK372} + S-adenosylhomocysteine (methylation) | Rad23A(h) + mdm2(h) + p53(h) <==> Rad23A(h):mdm2(h):p53(h) (binding) | Set9(h) + p53(h) <==> Set9(h):p53(h) (binding) | ASPP1(h) + p53(h) <==> ASPP1(h):p53(h) (binding) | ASPP2(h) + p53(h) <==> ASPP2(h):p53(h) (binding) | p53(h) + ATP --Aurora-A(h)--> p53(h){pS215} + ADP (phosphorylation) | iASPP(h) + p53(h) <==> iASPP(h):p53(h) (binding) | Cables(h) + p53(h) <==> Cables(h):p53(h) (binding) | p53(h) + n ubiquitin(v.s.) --E1(y),Ubc5A(h),E4orf6(AD5),E1B55K(AD5),elongin B(v.s.),elongin C(v.s.),Roc1(m),ATP--> p53(h){ub(n)} (ubiquitination) | p53(h) + TAF(II)250-isoform2(h) <==> p53(h):TAF(II)250-isoform2(h) (binding) | p53(h) + TFIIA(h) <==> p53(h):TFIIA(h) (binding) | sin3a(h) + p53(h) <==> sin3a(h):p53(h) (binding) | p53(h) + Bcl-X(h) <==> p53(h):Bcl-X(h) (binding) | sin3a(m) + p53(h) <==> sin3a(m):p53(h) (binding) | securin(h) + p53(h) <==> securin(h):p53(h) (binding) | ING1b(h) + p53(h) <==> ING1b(h):p53(h) (binding) | HAUSP(h) + p53(h) <==> HAUSP(h):p53(h) (binding) | Cables(v.s.) + p53(h) <==> Cables(v.s.):p53(h) (binding) | Cables2(v.s.) + p53(h) <==> Cables2(v.s.):p53(h) (binding) | plk1(h) + p53(h) <==> plk1(h):p53(h) (binding) | TSG101(h) + p53(h) <==> TSG101(h):p53(h) (binding) | p53(h) + sumo1(v.s.) --Aos1(m):SAE2(m),Ubc9(m)--> p53(h){sumoK386} (sumoylation) | p53(h) + sumo1(v.s.) --> p53(h){sumoK386} (sumoylation) | p53(h) + sumo1(v.s.) --Ubc9(h)--> p53(h){sumoK386} (sumoylation) | PIRH2(h) + p53(h) <==> PIRH2(h):p53(h) (binding) | p53(h) + n ubiquitin(v.s.) --PIRH2(v.s.)--> p53(h){ub(n)} (ubiquitination) | p53(h) + n ubiquitin(v.s.) --E1(rb),Ubc5B(h),PIRH2(v.s.)--> p53(h){ub(n)} (ubiquitination) | p53(h) + Bcl-2(h) <==> p53(h):Bcl-2(h) (binding) | CtBP2(h) + mdm2(h) + p53(h) <==> CtBP2(h):mdm2(h):p53(h) (binding) | p53(h) --> Cytochrome C(m) (activation; translocation) | p53(h) --> Bak(h):Bak(h) (activation; oligomerization) | YY1(h) + p53(h) <==> YY1(h):p53(h) (binding) | Sel-1(h) + p53(h) <==> Sel-1(h):p53(h) (binding) | p53(h) --Ref-1(h)--> p53(h){re} (redox reaction) | p53(h) + FOXO3a(h) <==> FOXO3a(h):p53(h) (binding) | p53(h) --> TNFRSF10C(h) (DNA binding; transactivation). | p53(h) --> SCN3B(h) (DNA binding; transactivation). | p53(h) --/ CHEK1(h) (DNA binding; transrepression). | p53(h) --/ PTTG1(h) (DNA binding; transrepression). | p53(h) + 5 acetyl-CoA --p300(h)--> p53(h){aceK370}{aceK372}{aceK373}{aceK381}{aceK382} + 5 CoA (acetylation) | p53(h) + SMAR1-isoform1(m) <==> p53(h):SMAR1-isoform1(m) (binding) | p53(h) + Delta40p53(h) <==> p53(h):Delta40p53(h) (binding) | p53beta(h) + p53(h) <==> p53beta(h):p53(h) (binding) | p53(h) --> p21Cip1(h) (increase of abundance) | p53(h) --> PAI1(h) (increase of abundance) | Smad2(h) + p53(h) <==> Smad2(h):p53(h) (binding) | Smad3(h) + p53(h) <==> Smad3(h):p53(h) (binding) | Ubc9(m.s.) + p53(h) <==> Ubc9(m.s.):p53(h) (binding) | RPA2(h) + p53(h) <==> RPA2(h):p53(h) (binding) | p53(h) + n ubiquitin(h) --> p53(h){ub(n)} (ubiquitination) | sumo1(m.s.) + p53(h) --> p53(h){sumoK386} (sumoylation) | mdm2-isoform1(h) + p53(h) <==> mdm2-isoform1(h):p53(h) (binding) | mdm2-isoform1(h){pS269} + p53(h) <==> mdm2-isoform1(h){pS269}:p53(h) (binding) | p53(h) --> protein remnants (degradation) | p53(h) + mdm2(m) <==> p53(h):mdm2(m) (binding) | T3R-alpha(c) + p53(h) <==> T3R-alpha(c):p53(h) (binding) | p53(h) + ATP --> p53(h){pS15} + ADP (phosphorylation) | p53(h) + acetyl-CoA --> p53(h){aceK382} + CoA (acetylation) | p300(h) + p53(h) + ING2(h) <==> p300(h):p53(h):ING2(h) (binding) | ING2(m.s.) + p300(h) + p53(h) <==> ING2(m.s.):p300(h):p53(h) (binding) | ING2(m.s.) + p53(h) <==> ING2(m.s.):p53(h) (binding) | p53(h) + HDAC1(m.s.) <==> p53(h):HDAC1(m.s.) (binding) | mdm2-isoform1(h) + HDAC1(m.s.) + p53(h) <==> mdm2-isoform1(h):HDAC1(m.s.):p53(h) (binding) | p53(h) + 6 acetyl-CoA --CBP(m.s.)--> p53(h){aceK320}{aceK370}{aceK372}{aceK373}{aceK381}{aceK382} + 6 CoA (acetylation) | p53(h) + n ubiquitin(h) --mdm2(m)--> p53(h){ub(n)} (ubiquitination) | p53(h) --> protein remnants (degradation) | p53(h) + n ubiquitin(h) --mdm2-isoform1(h)--> p53(h){ub(n)} (ubiquitination) | p53(h) --/ STAT1(h) (decrease of abundance) | PC4(h) + p53(h) <==> PC4(h):p53(h) (binding) | 53BP1(h) + BLM(h) + p53(h) <==> 53BP1(h):BLM(h):p53(h) (binding) | Polb(m) + p53(h) <==> Polb(m):p53(h) (binding) | p53(h) + RPA1(h) <==> p53(h):RPA1(h) (binding) | p53(h) + Phb(h) <==> p53(h):Phb(h) (binding) | p53(h) + Phb(m.s.) <==> p53(h):Phb(m.s.) (binding) | p53(h) + mtTFA(h) <==> p53(h):mtTFA(h) (binding) | p53(h) + NTH1(h) <==> p53(h):NTH1(h) (binding) | p53(h) + ATP --RSK2(h)--> p53(h){pS15} + ADP (phosphorylation) | p53(h) + ATP --RSK2(m.s.)--> p53(h){pS15} + ADP (phosphorylation) | p53(h) --> CDKN1A(h) (transactivation) | p53(m) + p53(h) <==> p53(m):p53(h) (oligomerization) | p53(h) + AP-2alpha(h) <==> p53(h):AP-2alpha(h) (binding) | NF-IL6-1(h) + p53(h) <==> NF-IL6-1(h):p53(h) (binding) | p53(h) + GSK3beta(h) <==> p53(h):GSK3beta(h) (binding) | p53(h) --Caspase(h)--> protein remnants (cleavage) | GTBP(h) + p53(h) <==> GTBP(h):p53(h) (binding) | MSH2(h) + p53(h) <==> MSH2(h):p53(h) (binding) | p53(h) + Rad51(h) <==> p53(h):Rad51(h) (binding) | p53(h) + ATP --> p53(h){p} + ADP (phosphorylation) | p53(h) --> p53(h) (translocation) | RNF96(h) + mdm2-isoform1(h) + p53(h) <==> RNF96(h):mdm2-isoform1(h):p53(h) (binding) | HDAC1(m.s.) + p53(h) <==> HDAC1(m.s.):p53(h) (binding) | p53(h) + 2 acetyl-CoA --> p53(h){aceK373}{aceK382} + 2 CoA (acetylation) | p53(h) + ubiquitin(h) --mdm2-isoform1(h)--> p53(h){ub} (ubiquitination) | p53(h) + p300(h) <==> p53(h):p300(h) (binding) | p53(h) + PTEN(h) <==> p53(h):PTEN(h) (binding) | p53(h) + MULE(h) <==> p53(h):MULE(h) (binding) | p53(h) + HCV-NS5A(HCV) <==> HCV-NS5A(HCV):p53(h) (binding) | p53(h) --> p53(h) (translocation) | p53(h) + HCV-NS5A-1B-Japanese(HCV1BJapan) <==> HCV-NS5A-1B-Japanese(HCV1BJapan):p53(h) (binding) | p53(h) --> p53(h) (translocation) | p53(h) --> p53(h) (translocation) | p53(h) + TBP(h) <==> p53(h):TBP(h) (binding) | p53(h) + bad(h) <==> p53(h):bad(h) (binding) | p53(h) --> bad(h) (increase of abundance) | p53(h) --> BAD(h) (transactivation) | p53(h) --> p53(h) (translocation) | p53(h) + HCV-NS5A-1B(HCV1B) <==> p53(h):HCV-NS5A-1B(HCV1B) (binding) | p53(h) + 3 Nedd8(h) --mdm2-isoform1(m)--> p53(h){neddK370}{neddK372}{neddK373} (neddylation) | p53(h) + 6 ubiquitin(h) --mdm2-isoform1(m)--> p53(h){ubK370}{ubK372}{ubK373}{ubK381}{ubK382}{ubK386} (ubiquitination) | p53(h) + Nedd8(h) --> p53(h){nedd} (neddylation) | p53(h) + ubiquitin(h) --> p53(h){ub} (ubiquitination) | p53(h) + n ubiquitin(h) --LUN-isoform1(h)--> p53(h){ub}n (ubiquitination) | p53(h) + n ubiquitin(h) --mdm2(h)--> p53(h){ub}n (ubiquitination) | p53(h) --26S proteasome(h)--> protein remnants (degradation) | p53(h) + (14-3-3tau(m.s.))2 <==> p53(h):(14-3-3tau(m.s.))2 (binding) | p53(h) + n SUMO2(h) --> p53(h){sumo2}n (sumoylation) | p53(h) + n sumo3(m.s.) --> p53(h){sumo3}n (sumoylation) | p53(h) + SUMO2(h) --> p53(h){sumo2} (sumoylation) | p53(h) + sumo3(m.s.) --> p53(h){sumo3} (sumoylation) | p53(h) + 7 ATP --> p53(h){pS6}{pS9}{pS15}{pS20}{pS37}{pS46}{pS392} + 7 ADP (phosphorylation) | p53(h) + ATP --> p53(h){pS15}{pS46} + ADP (phosphorylation) | p53(h) --> PTEN(h) (increase of abundance) | p53(h) --> PTEN(h) (transactivation) | p53(h) + 2 ATP --> p53(h){pS15}{pS20} + 2 ADP (phosphorylation) | p53(h) + ATP --PKCdelta(h)--> p53(h){pS46} + ADP (phosphorylation) | p53(h) + ATP --PKCdelta(h)--> p53(h){pS46} + ADP (phosphorylation) | p53(h) + PKCdelta(h) <==> p53(h):PKCdelta(h) (binding) | PKCdelta(h) + p53(h) <==> PKCdelta(h):p53(h) (binding) | p53(h) --> p53(h) (translocation) | Bax(h) + p53(h) <==> Bax(h):p53(h) (binding) | p53(h) + 2 acetyl-CoA --> p53(h){aceK305}{aceK382} + 2 CoA (acetylation) | p53(h) + CBP(h) <==> p53(h):CBP(h) (binding) | p53(h) + CBP(m.s.) <==> p53(h):CBP(m.s.) (binding) | p53(h) + jmy(h) <==> p53(h):jmy(h) (binding) | p53(h) + Pin1(m.s.) <==> p53(h):Pin1(m.s.) (binding) | p53(h) --> Psrc1(m) (DNA binding; transactivation). | p53(h) --> PMAIP1(h) (transactivation) | Fbx11-isoform1(h) + mdm2(h) + p53(h) <==> Fbx11-isoform1(h):mdm2(h):p53(h) (binding) | Fbx11-isoform1(h) + p53(h) <==> Fbx11-isoform1(h):p53(h) (binding) | Fbx11(h) + p53(h) <==> Fbx11(h):p53(h) (binding) | p53(h) + ubiquitin(h) --mdm2(m.s.)--> p53(h){ub} (ubiquitination) | p53(h) + 2 Nedd8(m.s.) --Fbx11-isoform1(h)--> p53(h){neddK320}{neddK321} (neddylation) | p53(h) + Nedd8(h) --APP-BP1(h):Uba3(h),Ubc12(h),SCF-Fbx11(h)--> p53(h){nedd} (neddylation) | p53(h) + axin(m.s.) + Daxx(h) <==> p53(h):axin(m.s.):Daxx(h) (binding) | p53(h) + 4 ATP --> p53(h){pS6}{pS9}{pS15}{pS46} + 4 ADP (phosphorylation) | p53(h) + BARD1(m.s.):brca1(h):BRCA2(h):BRCC36(h):BRE(h):Rad51(h) <==> brca1(h):Rad51(h):BRCA2(h):BARD1(m.s.):BRCC36(h):BRE(h):p53(h) (binding) | p53(h) --> CD82(h) (DNA binding). | p53(h) --> APAF1(h) (DNA binding; transactivation). | p53(h) + brca1(h) <==> p53(h):brca1(h) (binding) | p53(h) + ATP --DNA-PK(h)--> p53(h){p} + ADP (phosphorylation) | APP(h) + p53(h) <==> APP(h):p53(h) (binding) | p53(h) + AICD57(m.s.) <==> p53(h):AICD57(m.s.) (binding) | p53(h) + CUL4A(m.s.) <==> p53(h):CUL4A(m.s.) (binding) | p53(h) + IKK-alpha(m.s.) <==> p53(h):IKK-alpha(m.s.) (binding) | p53(h) + IKK-alpha(h) <==> p53(h):IKK-alpha(h) (binding) | p53(h) + ATP --IKK-alpha(h)--> p53(h){pS20} + ADP (phosphorylation) | p53(h) --> GADD45A(h) (transactivation) | trkA(h) + p53(h) <==> trkA(h):p53(h) (binding) | c-Ets-1(h) + p53(h) <==> c-Ets-1(h):p53(h) (binding) | PPARgamma(h) + p53(h) <==> PPARgamma(h):p53(h) (binding) | p16INK4a-p14(h) + p53(h) + rad6(h) <==> p16INK4a-p14(h):p53(h):rad6(h) (binding) | rad6(h) + p53(h) <==> rad6(h):p53(h) (binding) | p53(h) --> p53(h){ub} (ubiquitination) | p53(h) + Ubc13(h) <==> p53(h):Ubc13(h) (binding) | n p53(h) <==> (p53(h))n (oligomerization) | Bak(h) + p53(h) <==> Bak(h):p53(h) (binding) | p53(h) --> MIRN34A(h) (transactivation) | p53(h) --/ FTH1(h) (transrepression) | Dvl-2(h) + p53(h) <==> Dvl-2(h):p53(h) (binding) | p53(h) + mageb18(h) <==> p53(h):mageb18(h) (binding) | p53(h) --> TERT(h) (DNA binding). | CHIP(h) + p53(h) <==> CHIP(h):p53(h) (binding) | p53(h) + muc1(m.s.) <==> p53(h):muc1(m.s.) (binding) | p53(h) + muc1(h) <==> p53(h):muc1(h) (binding) | p53(h) --> FAS(h) (DNA binding). | p53(h) + Bak(h) <==> p53(h):Bak(h) (binding) | p53(h) + Bcl-xL(m.s.) <==> p53(h):Bcl-xL(m.s.) (binding) | calcyclin(h) + p53(h) <==> calcyclin(h):p53(h) (binding) | calcyclin(h) + p53(h) <==> calcyclin(h):p53(h) (binding) | p53(h) + 2 ubiquitin(h) --> p53(h){ub(2)} (ubiquitination) | p53(h) + C/EBPbeta(h) <==> p53(h):C/EBPbeta(h) (binding) | p53(h) --> ZMAT3(h) (transactivation) | p53(h) --> WIG1(h) (increase of abundance) | p53(h) --> SUB1(h) (DNA binding). | p53(h) --> Pold1(h) (DNA binding). | p53(h) --> MIRN192(h) (DNA binding). | p53(h) --> GDF15(h) (transactivation) | p53(h) --> MIC-1(h) (increase of abundance) | p53(h) --> BTG2(h) (transactivation) | p53(h) --> DRAM(h) (transactivation) | p53(h) + 2 ATP --> p53(h){pS15}{pS37} + 2 ADP (phosphorylation) | p53(h) + NDKA(m.s.) <==> p53(h):NDKA(m.s.) (binding) | p53(h) + STRAP(m.s.) <==> p53(h):STRAP(m.s.) (binding) | NDKA(h) + p53(h) <==> NDKA(h):p53(h) (binding) | STRAP(h) + p53(h) <==> STRAP(h):p53(h) (binding) | p53(h) --> p53(h) (translocation) | mdm2(h) + p53(h) <==> mdm2(h):p53(h) (binding) | p53(h) + GIF(m.s.) <==> p53(h):GIF(m.s.) (binding) | GIF(h) + p53(h) <==> GIF(h):p53(h) (binding) | mdm2(m.s.) + p53(h) + GIF(m.s.) <==> mdm2(m.s.):p53(h):GIF(m.s.) (binding) | GIF(h) + mdm2(h) + p53(h) <==> GIF(h):mdm2(h):p53(h) (binding) | p53(h) --/ Gtse1(h) (transrepression) | gtse1(h) + p53(h) <==> gtse1(h):p53(h) (binding) | p53(h) --> PRODH(h) (DNA binding). | p53(h) --> Zmat3(m) (DNA binding). | p53(h) --> histone H4(h){ace} (increase of acetylation) | p53(h) --> histone H3(h){ace} (increase of acetylation) | p53(h) + acetyl-CoA --> p53(h){aceK120} + CoA (acetylation) | FAK(h) + p53(h) <==> FAK(h):p53(h) (binding) | p53(h) + n ubiquitin(h) --E1(m.s.),Ubc5A(m.s.),mdm2(h)--> p53(h){ub}n (ubiquitination) | p53(h) --> TP73(h) (transactivation) | p18INK4c(h) + p53(h) <==> p18INK4c(h):p53(h) (binding) | ERH(h) + p53(h) <==> ERH(h):p53(h) (binding) | ZNF-24(h) + p53(h) <==> ZNF-24(h):p53(h) (binding) | Cdc42(h) + p53(h) <==> Cdc42(h):p53(h) (binding) | laminin-alpha4(h) + p53(h) <==> laminin-alpha4(h):p53(h) (binding) | platelet-activating factor acetylhydrolase IB subunit gamma(h) + p53(h) <==> platelet-activating factor acetylhydrolase IB subunit gamma(h):p53(h) (binding) | CAP3(h) + p53(h) <==> CAP3(h):p53(h) (binding) | inorganic pyrophosphatase 1(h) + p53(h) <==> inorganic pyrophosphatase 1(h):p53(h) (binding) | S9(h) + p53(h) <==> S9(h):p53(h) (binding) | SSAT(h) + p53(h) <==> SSAT(h):p53(h) (binding) | PARC(h) + p53(h) <==> PARC(h):p53(h) (binding) | snrpn(h) + p53(h) <==> snrpn(h):p53(h) (binding) | STE(h) + p53(h) <==> STE(h):p53(h) (binding) | TK1(h) + p53(h) <==> TK1(h):p53(h) (binding) | eIF-2beta(h) + p53(h) <==> eIF-2beta(h):p53(h) (binding) | p31-comet(h) + p53(h) <==> p31-comet(h):p53(h) (binding) | M-phase-phosphoprotein6(h) + p53(h) <==> M-phase-phosphoprotein6(h):p53(h) (binding) | Ari-2(h) + p53(h) <==> Ari-2(h):p53(h) (binding) | tmsb4x(m) + p53(h) <==> tmsb4x(m):p53(h) (binding) | BTBD2(h) + p53(h) <==> BTBD2(h):p53(h) (binding) | CNR1(h) + p53(h) <==> CNR1(h):p53(h) (binding) | Annexin-A3(h) + p53(h) <==> Annexin-A3(h):p53(h) (binding) | arl3(h) + p53(h) <==> arl3(h):p53(h) (binding) | ATF-3(h) + p53(h) <==> ATF-3(h):p53(h) (binding) | bcr(h) + p53(h) <==> bcr(h):p53(h) (binding) | gstm4(h) + p53(h) <==> gstm4(h):p53(h) (binding) | Hsp27(h) + p53(h) <==> Hsp27(h):p53(h) (binding) | purine nucleoside phosphorylase(h) + p53(h) <==> purine nucleoside phosphorylase(h):p53(h) (binding) | Syntaxin5(h) + p53(h) <==> Syntaxin5(h):p53(h) (binding) | Cox17(h) + p53(h) <==> Cox17(h):p53(h) (binding) | dleu1(h) + p53(h) <==> dleu1(h):p53(h) (binding) | Ccte(h) + p53(h) <==> Ccte(h):p53(h) (binding) | fxyd6(h) + p53(h) <==> fxyd6(h):p53(h) (binding) | WDR33(h) + p53(h) <==> WDR33(h):p53(h) (binding) | hdac2(h){p} + p53(h) <==> hdac2(h){p}:p53(h) (binding) | p53(h) --> ATF3(h) (transactivation) | p53(h) --/ cdc25A(h) (transrepression) | p53(h) --/ Cdc25A(h) (inhibition; decrease of abundance) | p53(h) --/ slug(h) (decrease of abundance) | p53(h) --> mdm2(h) (increase of abundance) | slug(h) + p53(h) <==> slug(h):p53(h) (binding) | mdm2(h) + p53(h) + slug(h) <==> mdm2(h):p53(h):slug(h) (binding) | mdm2(h) + slug(h) + p53(h) <==> mdm2(h):slug(h):p53(h) (binding) | p53(h) --/ slug(h) (decrease of abundance) | p53(h) --> E-cadherin(h) (increase of abundance) | Apak(h) + p53(h) <==> Apak(h):p53(h) (binding) | HDAC1(h) + RNF96(h) + Apak(h) + ATM(h) + p53(h) <==> HDAC1(h):RNF96(h):Apak(h):ATM(h):p53(h) (binding) | p53(h) + Apak(h) + ATM(h) <==> p53(h):Apak(h):ATM(h) (binding) | HAUSP(h) + p53(h) + Daxx(h) + mdm2(h) <==> HAUSP(h):p53(h):Daxx(h):mdm2(h) (binding) | p53(h) --> MMP2(h) (DNA binding). | p53(h) + chd8(h) <==> p53(h):chd8(h) (binding) | p53(h) + chd8-isoform2(m) <==> p53(h):chd8-isoform2(m) (binding) | chd8-isoform1(h) + p53(h) <==> chd8-isoform1(h):p53(h) (binding) | p53(h) --> TRIAP1(h) (transactivation) | p53(h) --> HSPC132(h) (increase of abundance) | p53(h) + 2 ATP --> p53(h){pS15}{pS392} + 2 ADP (phosphorylation) | p53(h) --> SCF(h) (increase of abundance) | p53(h) --> ET-1(h) (increase of secretion) | p53(h) --> KITLG(h) (transactivation) | p53(h) --> tyrosinase(h) (increase of abundance) | p53(h) --> c-Kit(h) (increase of abundance) | p53(h) --> melanin (increase of abundance) | p53(h) --> NOTCH1(h) (transactivation) | p53(h) --> KRT1(h) (transactivation) | p53(h) --/ IGF2(h) (transrepression) | p53(h) --/ Upp1(m) (transrepression) | p53(h) --> EGFR(h) (DNA binding; transactivation). | p53(h) --> BAX(m) (DNA binding). | p53(h) --/ Slc2a1(r) (transrepression) | p53(h) + 3 ATP --> p53(h){pS6}{pS9}{pS392} + 3 ADP (phosphorylation) | Sox4(h) + p53(h) <==> Sox4(h):p53(h) (binding) | p53(h) + Sox4(h) <==> p53(h):Sox4(h) (binding) | p53(h) + 2 acetyl-CoA --p300(m.s.)--> p53(h){aceK373}{aceK382} + 2 CoA (acetylation) | p53(h) + 2 acetyl-CoA --CBP(m.s.)--> p53(h){aceK373}{aceK382} + 2 CoA (acetylation) | p300(m.s.) + p53(h) <==> p300(m.s.):p53(h) (binding) | p53(h) + Mdm4(h) <==> p53(h):Mdm4(h) + p53(h):Mdm4(h) (binding) | p53(h) --/ PTTG1(h) (transrepression) | psmc4(m.s.) + mdm2(m) + p53(h) <==> psmc4(m.s.):mdm2(m):p53(h) (binding) | p53(h) --/ Ifi202b(m) (transrepression) | S5a(m.s.) + mdm2(m) + p53(h) <==> S5a(m.s.):mdm2(m):p53(h) (binding) | p53(h) + ATP --plk1(h)--> p53(h){p} + ADP (phosphorylation) | p53(h) + ubiquitin(h) --E1(rb),Ubc5A(h),mdm2(h)--> p53(h){ub} (ubiquitination) | p53(h) + n ubiquitin(h) --E1(rb),mdm2(h),Ubc5A(h)--> p53(h){ub(n)} (ubiquitination) | p53(h) + ubiquitin(h) --mdm2(h)--> p53(h){ub} (ubiquitination) | 2 p53(h) <==> (p53(h))2 (binding; oligomerization) | p53(h) + sumo1(h) --> p53(h){sumo} (sumoylation) | p53(h) + PIASy(h) <==> p53(h):PIASy(h) (binding) | p53(h) --> mdm2(m.s.) (transactivation) | p53(h) --/ APP(h) (DNA binding; transrepression). | p53(h) --> GSTP1(h) (DNA binding). | p53(h) --/ HSPCB(h) (DNA binding; transrepression). | p53(h) --> MSH2(h) (DNA binding; transactivation). | p53(h) --> Slc2a4(r) (DNA binding; transactivation). | p53(h) --> Bdkrb2(r) (DNA binding). | p53(h) --> EPHA2(h) (DNA binding; transactivation). | p53(h) --> BCL6(h) (DNA binding). | p53(h) --> DUSP4(h) (DNA binding). | p53(h) --> IFI16(h) (DNA binding). | p53(h) --> MUC2(h) (DNA binding). | p53(h) --> CDC20(h) (DNA binding). | p53(h) --> Ier3(r) (DNA binding). | TP53(h) --> p53(h) (expression). | p53(h){ace} --SIRT1(m)--> p53(h) + acetyl (deacetylation) | p53(h){ace} --SIRT1(h)--> p53(h) + acetyl (deacetylation) | p53(h){ace} --HDAC1(h)--> p53(h) + acetyl (deacetylation) | p53(h){ace} --MTA1L1(h):Mi2-BETA(h):HDAC1(h):RbAp48(h):mbd3(h)--> acetyl + p53(h) (deacetylation) | p53(h){pS315} --Cdc14A(h)--> p53(h) + p (dephosphorylation) | p53(h){pS315} --Cdc14B(h)--> p53(h) + p (dephosphorylation) | p53(h){ub(n)} --UBP1(y)--> p53(h) + n ubiquitin(v.s.) (deubiquitination) | p53(h){ub(n)} --HAUSP(h)--> p53(h) + n ubiquitin(h) (deubiquitination) | Sfrs10(h) --> p53(h) (activation) | Myosin IXb(h) --> p53(h) (activation) | OSR1(h) --> p53(h) (activation) | GSK3(h) --/ p53(h) (decrease of abundance) | GSK3beta(m.s.) --/ p53(h) (decrease of abundance) | T3R-beta1(h) --> p53(h) (increase of abundance) | WT1(m.s.) --> p53(h) (increase of abundance) | p53(h){aceK320}{aceK373}{aceK382} --HDAC1(m.s.)--> p53(h) (deacetylation) | GSK3beta(h){p} --> p53(h) (increase of abundance) | GSK3beta(h) --/ p53(h) (decrease of abundance) | p16INK4a(m.s.) --> p53(h) (increase of abundance) | p53(h){pS15} --> p53(h) + p (dephosphorylation) | p53(h){pS15} --Wip1(m.s.)--> p53(h) + p (dephosphorylation) | p53(h) --> p53(h) (translocation) | mdm2(h) --/ p53(h) (decrease of abundance) | COP1(h) --/ p53(h) (decrease of abundance) | PIRH2(h) --/ p53(h) (decrease of abundance) | p16INK4a-xbb1(h) --> p53(h) (increase of abundance) | p53(h) --> p53(h) (translocation) | p53(h) --> p53(h) (translocation) | p53(h) --> p53(h) (translocation) | p53(h) --> p53(h) (translocation) | HCV-NS5A-1A-H(HCV1AH) --> p53(h) (increase of abundance) | p16INK4a-p14(h) --> p53(h) (increase of abundance) | HAUSP(h) --> p53(h) (increase of abundance) | 14-3-3gamma(h) --> p53(h) (increase of abundance) | Mdm4(h) --/ p53(h) (decrease of abundance) | p53(h) --> p53(h) (translocation) | Cdc6-p49(h) --> p53(h) (increase of abundance) | Cdc6-p32(h) --> p53(h) (increase of abundance) | p/CAF(h) --> p53(h) (increase of abundance) | BAAT1(h) --/ p53(h) (decrease of abundance) | p53(h){pS15} --PP2A(h)--> p53(h) + ATP (dephosphorylation) | PS2(m.s.) --> p53(h) (increase of abundance) | PS1(m.s.) --/ p53(h) (decrease of abundance) | IGFBP-2(h) --> p53(h) (increase of abundance) | estradiol --> p53(h) (increase of abundance) | UHX1(h) --> p53(h) (increase of abundance) | IKK-alpha(h) --> p53(h) (increase of abundance) | NDKA(h) --> p53(h) (increase of abundance) | STRAP(h) --> p53(h) (increase of abundance) | p53(h) --> p53(h) (translocation) | GIF(m.s.) --/ p53(h) (decrease of abundance) | GIF(h) --/ p53(h) (decrease of abundance) | gtse1(h) --/ p53(h) (decrease of abundance) | TNF-alpha(m.s.) --> p53(h) (increase of abundance) | slc5a3(h) --> p53(h) (increase of abundance) | RASSF1-A(m.s.) --> p53(h) (activation; increase of abundance) | Apak(h) --/ p53(h) (decrease of abundance) | rps6(h) --/ p53(h) (decrease of abundance) | rpl11(h) --/ p53(h) (decrease of abundance) | rps23(h) --/ p53(h) (decrease of abundance) | rpl7a(h) --/ p53(h) (decrease of abundance) | TIP30(m.s.) --> p53(h) (increase of abundance) | UBP41(h) --/ p53(h) (inhibition; decrease of abundance) | p53(h){ub} --HAUSP(h)--> p53(h) + ubiquitin(h) (deubiquitination) | EIF5A1-isoform1(h) --> p53(h) (increase of abundance). | EIF5A1(h) --> p53(h) (increase of abundance) | Syntenin(h) --/ p53(h) (decrease of abundance) | mdm2(h) + ATP --CKII-alpha(h):CKII-alpha2(h):(CKII-beta(h))2--> mdm2(h){p} + ADP (phosphorylation) | nucleolin(h) + ATP --CKII-alpha(h):CKII-alpha2(h):(CKII-beta(h))2--> nucleolin(h){p} + ADP (phosphorylation) | cyclinH(h) + ATP --CKII-alpha(h):CKII-alpha2(h):(CKII-beta(h))2--> cyclinH(h){p} + ADP (phosphorylation) | p53-isoform1(h) --> M-PGAM(r) (DNA binding). | p53-isoform1(h) --> FAC(h) (DNA binding; transactivation). | p53-isoform1(h) --> APC(h) (DNA binding; transactivation). | p53-isoform1(h) --> CD82(h) (DNA binding; transactivation). | p53-isoform1(h) --> Fas(m) (DNA binding; transactivation). | p53-isoform1(h) --> IGFBP3(h) (DNA binding; transactivation). | p53-isoform1(h) --> Lrdd(m) (DNA binding; transactivation). | p53-isoform1(h) --> Ei24(m) (DNA binding). | p53-isoform1(h) --> Met(m) (DNA binding; transactivation). | p53-isoform1(h) --> GPX(h) (DNA binding; transactivation). | p53-isoform1(h) --> S100A2(h) (DNA binding; transactivation). | p53-isoform1(h) --> SESN1(h) (DNA binding; transactivation). | p53-isoform1(h) --> mdr1b(r) (DNA binding; transactivation). | p53-isoform1(h) --> ACTA2(h) (DNA binding; transactivation). | p53-isoform1(h) --> HRAS(h) (DNA binding; transactivation). | p53-isoform1(h) --> MMP2(h) (DNA binding; transactivation). | p53-isoform1(h) --> PCNA(h) (DNA binding; transregulation). | p53-isoform1(h) --> EGFR(h) (DNA binding; transactivation). | p53-isoform1(h) --> TGFA(h) (DNA binding; transactivation). | p53-isoform1(h) --> CAV1(h) (DNA binding; transactivation). | p53-isoform1(h) --> Siah1b(m) (DNA binding; transactivation). | p53-isoform1(h) --> CX3CL1(h) (DNA binding; transactivation). | p53-isoform1(h) --> DKK1(h) (DNA binding; transactivation). | p53-isoform1(h) --> MSH2(h) (DNA binding; transactivation). | p53-isoform1(h) --> TNFRSF10B(h) (DNA binding; transactivation). | p53-isoform1(h) --> STAF50(h) (DNA binding; transactivation). | p53-isoform1(h) --> DUSP1(h) (DNA binding; transactivation). | p53-isoform1(h) --> P53AIP1(h) (DNA binding; transactivation). | p53-isoform1(h) --> DDB2(h) (DNA binding; transactivation). | p53-isoform1(h) --> TRAF4(m) (DNA binding; transactivation). | p53-isoform1(h) --> SIVA(m) (DNA binding; transactivation). | p53-isoform1(h) --> ATF3(h) (DNA binding; transactivation). | p53-isoform1(h) --> SERPINB5(h) (DNA binding). | p53-isoform1(h) --> NDRG1(h) (DNA binding). | p53-isoform1(h) --> TP53INP1(h) (DNA binding; transactivation). | p53-isoform1(h) --/ PTK2(h) (DNA binding; transrepression). | p53-isoform1(h) --> mmp2(h) (increase of abundance) | p53-isoform1(h) --> Ccng1(r) (DNA binding; transactivation). | p53-isoform1(h) --> TP73(h) (DNA binding; transactivation). | p53-isoform1(h) --> CDKN1A(h) (DNA binding; transactivation). | p53-isoform1(h) --> BAX(h) (DNA binding). | p53-isoform1(h) --> MDM2(h) (DNA binding). | PC4(h) + p53-isoform1(h) <==> PC4(h):p53-isoform1(h) (binding) | p53-isoform1(h) --> Bax(h) (increase of abundance) | RPA2(h) + p53-isoform1(h) <==> RPA2(h):p53-isoform1(h) (binding) | p53-isoform1(h) + RPA1(h) <==> p53-isoform1(h):RPA1(h) (binding) | p53-isoform1(h) + RPA1(h) <==> p53-isoform1(h):RPA1(h) (binding) | p53-isoform1(h) + SRC-1A(h) <==> p53-isoform1(h):SRC-1A(h) (binding) | p53-isoform1(h) + CBP(m.s.) <==> p53-isoform1(h):CBP(m.s.) (binding) | p53-isoform1(h) + SRC3(m) <==> p53-isoform1(h):SRC3(m) (binding) | p53-isoform1(h) + SRC3(h) <==> p53-isoform1(h):SRC3(h) (binding) | p53-isoform1(h) + mtTFA(h) <==> p53-isoform1(h):mtTFA(h) (binding) | p53-isoform1(h) + RSK2(h) <==> p53-isoform1(h):RSK2(h) (binding) | p53-isoform1(h) + ATP --RSK2(m.s.)--> p53-isoform1(h){pS15} + ADP (phosphorylation) | p53-isoform1(h) + ATP --ERK2(m.s.)--> p53-isoform1(h){p} + ADP (phosphorylation) | p53-isoform1(h) + ATP --RSK1(m.s.)--> p53-isoform1(h){p} + ADP (phosphorylation) | p53-isoform1(h) --> p53-isoform1(h) (translocation) | p53-isoform1(h) + xSRC-3(x) <==> p53-isoform1(h):xSRC-3(x) (binding) | SRP1alpha(h) + p53-isoform1(h) <==> SRP1alpha(h):p53-isoform1(h) (binding) | p53-isoform1(h) + AP-2gamma(h) <==> p53-isoform1(h):AP-2gamma(h) (binding) | p53-isoform1(h) + AP-2alpha(h) <==> p53-isoform1(h):AP-2alpha(h) (binding) | p53-isoform1(h) + HRMT1L2(m.s.) <==> p53-isoform1(h):HRMT1L2(m.s.) (binding) | p53-isoform1(h) + carm1(m.s.) <==> p53-isoform1(h):carm1(m.s.) (binding) | p53-isoform1(h) + CBP(m.s.) + HRMT1L2(m.s.) <==> p53-isoform1(h):CBP(m.s.):HRMT1L2(m.s.) (binding) | p53-isoform1(h) + CBP(m.s.) + carm1(m.s.) <==> p53-isoform1(h):CBP(m.s.):carm1(m.s.) (binding) | p53-isoform1(h) + NF-IL6-1(h) <==> p53-isoform1(h):NF-IL6-1(h) (binding) | p53-isoform1(h) + NF-IL6-3(h) <==> p53-isoform1(h):NF-IL6-3(h) (binding) | p53-isoform1(h) + GSK3beta(h) <==> p53-isoform1(h):GSK3beta(h) (binding) | p53-isoform1(h) + GSK3beta(m.s.) <==> p53-isoform1(h):GSK3beta(m.s.) (binding) | p53-isoform1(h) --> mdm2(h) (increase of abundance) | p53-isoform1(h) --> p21Cip1(h) (increase of abundance) | p53-isoform1(h) --> MDM2(h) (transactivation) | p53-isoform1(h) --> CDKN1A(h) (transactivation) | p53-isoform1(h) --Caspase-3(m.s.)--> protein remnants (cleavage) | p53-isoform1(h) --Caspase-6(m.s.)--> protein remnants (cleavage) | p53-isoform1(h) --Caspase-7(m.s.)--> protein remnants (cleavage) | p53-isoform1(h) --> BAX(h) (transactivation) | p53-isoform1(h) --> protein remnants (cleavage) | p53-isoform1(h) --> TP53I3(h) (transactivation) | p53-isoform1(h) --> PIG3(h) (increase of abundance) | p53-isoform1(h) + E2F-1(h) <==> p53-isoform1(h):E2F-1(h) (binding) | E2F-1(m.s.) + p53-isoform1(h) <==> E2F-1(m.s.):p53-isoform1(h) (binding) | p53-isoform1(h) + ATP --> p53-isoform1(h){pS315} + ADP (phosphorylation) | p53-isoform1(h) + ubiquitin(h) --mdm2(m.s.)--> p53-isoform1(h){ub} (ubiquitination) | p53-isoform1(h) + n ubiquitin(h) --mdm2(m.s.)--> p53-isoform1(h){ub}n (ubiquitination) | p53-isoform1(h) + mdm2(m.s.) <==> p53-isoform1(h):mdm2(m.s.) (binding) | p53-isoform1(h) + sumo1(h) --> p53-isoform1(h){sumoK386} (sumoylation) | p53-isoform1(h) + sumo1(h) --Aos1(h):SAE2(h),Ubc9(h)--> p53-isoform1(h){sumoK386} (sumoylation) | p53-isoform1(h) + n ubiquitin(h) --E1(h),Ubc5A(h),mdm2-isoform1(h)--> p53-isoform1(h){ub}n (ubiquitination) | p53-isoform1(h) + 2 acetyl-CoA --p300(m.s.)--> p53-isoform1(h){aceK292}{aceK305} + 2 CoA (acetylation) | p53-isoform1(h) + 2 acetyl-CoA --p300(m.s.)--> p53-isoform1(h){aceK305}{aceK382} + 2 CoA (acetylation) | p53-isoform1(h) + 2 ATP --ATM(m.s.)--> p53-isoform1(h){pS15}{pS37} + 2 ADP (phosphorylation) | p53-isoform1(h) + 2 ATP --ATR(m.s.)--> p53-isoform1(h){pS15}{pS37} + 2 ADP (phosphorylation) | p53-isoform1(h) + 2 ATP --DNA-PK(m.s.)--> p53-isoform1(h){pS15}{pS37} + 2 ADP (phosphorylation) | p53-isoform1(h) + CHIP(h) <==> p53-isoform1(h):CHIP(h) (binding) | p53-isoform1(h) + CHIP(h) <==> p53-isoform1(h):CHIP(h) (binding) | p53-isoform1(h) --> Zmat3(m) (transactivation) | p53-isoform1(h) + Ubc9(h) <==> p53-isoform1(h):Ubc9(h) (binding) | p53-isoform1(h) + PIAS2-alpha(h) <==> p53-isoform1(h):PIAS2-alpha(h) (binding) | TP53(h) --> p53-isoform1(h) (expression). | mdm2(h) --/ p53-isoform1(h) (decrease of abundance) | p53-isoform1(h) --> p53-isoform1(h) (translocation) | 2 Delta40p53(h) <==> Delta40p53(h):Delta40p53(h) (binding) | 4 Delta40p53(h) <==> (Delta40p53(h))4 (binding; oligomerization) | p53(h) + Delta40p53(h) <==> p53(h):Delta40p53(h) (binding) | Delta40p53(h) + ubiquitin(v.s.) --> Delta40p53(h){ub} (ubiquitination) | TP53(h) --> Delta40p53(h) (expression). | p53beta(h) + p53(h) <==> p53beta(h):p53(h) (binding) | p53beta(h) --> CDKN1A(h) (DNA binding). | p53beta(h) --> BAX(h) (DNA binding). | TP53(h) --> p53beta(h) (expression). | TP53(h) --> p53gamma(h) (expression). | TP53(h) --> Delta40p53beta(h) (expression). | TP53(h) --> Delta40p53gamma(h) (expression). | TP53(h) --> Delta133p53(h) (expression). | TP53(h) --> Delta133p53beta(h) (expression). | TP53(h) --> Delta133p53gamma(h) (expression). |
---|
Post Transcriptional Modification [Top] | |||
Location (AA) |
PTM type |
Literature |
Database |
15 | Phosphoserine (by PRPK). | Swiss-Prot 53.0 | 18 | Phosphothreonine (by VRK1). | Swiss-Prot 53.0 | 46 | Phosphoserine (by HIPK2). | Swiss-Prot 53.0 | 55 | Phosphothreonine (by TAF1). | Swiss-Prot 53.0 | 305 | N6-acetyllysine. | Swiss-Prot 53.0 | 315 | Phosphoserine (by CDC2). | Swiss-Prot 53.0 | 373 | N6-acetyllysine. | Swiss-Prot 53.0 | 382 | N6-acetyllysine. | Swiss-Prot 53.0 | 392 | Phosphoserine (by CK2). | Swiss-Prot 53.0 | 37 | Phosphoserine (DNA-PK) | 11483158 | Phospho.ELM 6.0 | 9 | Phosphoserine | 11875057 | Phospho.ELM 6.0 | 15 | Phosphoserine (ATM;DNA-PK) | 11875057;10446957 | Phospho.ELM 6.0 | 46 | Phosphoserine (HIPK2) | 11875057;16729035 | Phospho.ELM 6.0 | 315 | Phosphoserine (Aurora A;CDK) | 92065884;14702041 | Phospho.ELM 6.0 | 20 | Phosphoserine (CHK2) | 12111733;10801407;15489221;15254178 | Phospho.ELM 6.0 | 371 | Phosphoserine (CDK7) | 9315650 | Phospho.ELM 6.0 | 376 | Phosphoserine (CDK7) | 9315650 | Phospho.ELM 6.0 | 378 | Phosphoserine (CDK7) | 9315650 | Phospho.ELM 6.0 | 215 | Phosphoserine (Aurora A) | 15469940 | Phospho.ELM 6.0 |
---|
Methylation Profile [Top] | ||
Chromosome |
Location |
Source |
---|---|---|
chr17 |
Promoter: 7531142 - 7533142 | GSE27584 |
chr17 |
Promoter: 7531142 - 7533142 | Agilent_014791 |
chr17 |
Promoter: 7531142 - 7533142 | PMID:17052263 |
chr17 |
Promoter: 7531142 - 7533142 | PMID:12579314 |
chr17 |
Promoter: 7531142 - 7533142 | PMID:16025287 |
chr17 |
Promoter: 7531142 - 7533142 | PMID:15885882 |
chr17 |
Promoter: 7531142 - 7533142 | PMID:17289889 |
chr17 |
Promoter: 7531142 - 7533142 | PMID:11804744 |
chr17 |
Promoter: 7531142 - 7533142 | PMID:11304577 |