| VIS ID | Virus | Ensembl ID | Gene Type | Target Gene | Oncogene | Tumor Suppressor Gene | NCBI ID | Uniprot ID |
|---|---|---|---|---|---|---|---|---|
| TVIS30067938 | HIV | ENSG00000128602.11 | protein_coding | SMO | Yes | No | 6608 | Q99835 |
| TVIS20068475 | HPV | ENSG00000128602.11 | protein_coding | SMO | Yes | No | 6608 | Q99835 |
Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | SMO |
|---|---|
| DrugBank ID | DB06786 |
| Drug Name | Halcinonide |
| Target ID | BE0004659 |
| UniProt ID | Q99835 |
| Regulation Type | agonist |
| PubMed IDs | 26658258 |
| Citations | Porcu G, Serone E, De Nardis V, Di Giandomenico D, Lucisano G, Scardapane M, Poma A, Ragnini-Wilson A: Clobetasol and Halcinonide Act as Smoothened Agonists to Promote Myelin Gene Expression and RxRgamma Receptor Activation. PLoS One. 2015 Dec 10;10(12):e0144550. doi: 10.1371/journal.pone.0144550. eCollection 2015. |
| Groups | Approved; Investigational; Withdrawn |
| Direct Classification | Gluco/mineralocorticoids, progestogins and derivatives |
| SMILES | [H][C@@]12C[C@H]3OC(C)(C)O[C@@]3(C(=O)CCl)[C@@]1(C)C[C@H](O)[C@@]1(F)[C@@]2([H])CCC2=CC(=O)CC[C@]12C |
| Pathways | |
| PharmGKB | |
| ChEMBL | CHEMBL1200845 |