| VIS ID | Virus | Ensembl ID | Gene Type | Target Gene | Oncogene | Tumor Suppressor Gene | NCBI ID | Uniprot ID |
|---|---|---|---|---|---|---|---|---|
| TVIS20056727 | HPV | ENSG00000144852.20 | protein_coding | NR1I2 | No | No | 8856 | O75469 |
Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | NR1I2 |
|---|---|
| DrugBank ID | DB00849 |
| Drug Name | Methylphenobarbital |
| Target ID | BE0000956 |
| UniProt ID | O75469 |
| Regulation Type | activator |
| PubMed IDs | 15039302 |
| Citations | Kobayashi K, Yamagami S, Higuchi T, Hosokawa M, Chiba K: Key structural features of ligands for activation of human pregnane X receptor. Drug Metab Dispos. 2004 Apr;32(4):468-72. |
| Groups | Approved |
| Direct Classification | Barbituric acid derivatives |
| SMILES | CCC1(C(=O)NC(=O)N(C)C1=O)C1=CC=CC=C1 |
| Pathways | |
| PharmGKB | PA450374 |
| ChEMBL | CHEMBL45029 |
