| VIS ID | Virus | Ensembl ID | Gene Type | Target Gene | Oncogene | Tumor Suppressor Gene | NCBI ID | Uniprot ID |
|---|---|---|---|---|---|---|---|---|
| TVIS44021886 | HTLV-1 | ENSG00000121966.8 | protein_coding | CXCR4 | Yes | No | 7852 | A0A0U3FJG0 A0A0U3GXA9 P61073 |
| TVIS44032449 | HTLV-1 | ENSG00000121966.8 | protein_coding | CXCR4 | Yes | No | 7852 | A0A0U3FJG0 A0A0U3GXA9 P61073 |
Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | CXCR4 |
|---|---|
| DrugBank ID | DB00452 |
| Drug Name | Framycetin |
| Target ID | BE0000919 |
| UniProt ID | P61073 |
| Regulation Type | antagonist |
| PubMed IDs | 11747436; 14638394 |
| Citations | Litovchick A, Lapidot A, Eisenstein M, Kalinkovich A, Borkow G: Neomycin B-arginine conjugate, a novel HIV-1 Tat antagonist: synthesis and anti-HIV activities. Biochemistry. 2001 Dec 25;40(51):15612-23.@@Borkow G, Vijayabaskar V, Lara HH, Kalinkovich A, Lapidot A: Structure-activity relationship of neomycin, paromomycin, and neamine-arginine conjugates, targeting HIV-1 gp120-CXCR4 binding step. Antiviral Res. 2003 Nov;60(3):181-92. |
| Groups | Approved |
| Direct Classification | 4,5-disubstituted 2-deoxystreptamines |
| SMILES | NC[C@@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@@H]2O)[C@H](N)[C@@H](O)[C@@H]1O |
| Pathways | Neomycin Action Pathway |
| PharmGKB | PA450608 |
| ChEMBL | CHEMBL184618 |
