| VIS ID | Virus | Ensembl ID | Gene Type | Target Gene | Oncogene | Tumor Suppressor Gene | NCBI ID | Uniprot ID |
|---|---|---|---|---|---|---|---|---|
| TVIS20001023 | HPV | ENSG00000120903.13 | protein_coding | CHRNA2 | No | No | 1135 | Q15822 |
Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | CHRNA2 |
|---|---|
| DrugBank ID | DB07720 |
| Drug Name | Epibatidine |
| Target ID | BE0000738 |
| UniProt ID | Q15822 |
| Regulation Type | agonist |
| PubMed IDs | 9454827 |
| Citations | Stauderman KA, Mahaffy LS, Akong M, Velicelebi G, Chavez-Noriega LE, Crona JH, Johnson EC, Elliott KJ, Gillespie A, Reid RT, Adams P, Harpold MM, Corey-Naeve J: Characterization of human recombinant neuronal nicotinic acetylcholine receptor subunit combinations alpha2beta4, alpha3beta4 and alpha4beta4 stably expressed in HEK293 cells. J Pharmacol Exp Ther. 1998 Feb;284(2):777-89. |
| Groups | Experimental |
| Direct Classification | Epibatidine analogues |
| SMILES | [H][C@@]12CC[C@@]([H])(N1)[C@]([H])(C2)C1=CC=C(Cl)N=C1 |
| Pathways | |
| PharmGKB | |
| ChEMBL | CHEMBL298826 |
