| VIS ID | Virus | Ensembl ID | Gene Type | Target Gene | Oncogene | Tumor Suppressor Gene | NCBI ID | Uniprot ID |
|---|---|---|---|---|---|---|---|---|
| TVIS20001023 | HPV | ENSG00000120903.13 | protein_coding | CHRNA2 | No | No | 1135 | Q15822 |
Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | CHRNA2 |
|---|---|
| DrugBank ID | DB00472 |
| Drug Name | Fluoxetine |
| Target ID | BE0000738 |
| UniProt ID | Q15822 |
| Regulation Type | antagonist |
| PubMed IDs | 9050901 |
| Citations | Garcia-Colunga J, Awad JN, Miledi R: Blockage of muscle and neuronal nicotinic acetylcholine receptors by fluoxetine (Prozac). Proc Natl Acad Sci U S A. 1997 Mar 4;94(5):2041-4. |
| Groups | Approved; Vet_approved |
| Direct Classification | Trifluoromethylbenzenes |
| SMILES | CNCCC(OC1=CC=C(C=C1)C(F)(F)F)C1=CC=CC=C1 |
| Pathways | Fluoxetine Metabolism Pathway; Fluoxetine Action Pathway |
| PharmGKB | PA449673 |
| ChEMBL | CHEMBL41 |