| VIS ID | Virus | Ensembl ID | Gene Type | Target Gene | Oncogene | Tumor Suppressor Gene | NCBI ID | Uniprot ID |
|---|---|---|---|---|---|---|---|---|
| TVIS44026442 | HTLV-1 | ENSG00000012779.12 | protein_coding | ALOX5 | Yes | Yes | 240 | P09917 |
| TVIS44036453 | HTLV-1 | ENSG00000012779.12 | protein_coding | ALOX5 | Yes | Yes | 240 | P09917 |
| TVIS44046443 | HTLV-1 | ENSG00000012779.12 | protein_coding | ALOX5 | Yes | Yes | 240 | P09917 |
Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | ALOX5 |
|---|---|
| DrugBank ID | DB00159 |
| Drug Name | Icosapent |
| Target ID | BE0000248 |
| UniProt ID | P09917 |
| Regulation Type | substrate |
| PubMed IDs | 3036459 |
| Citations | Austen KF: The role of arachidonic acid metabolites in local and systemic inflammatory processes. Drugs. 1987;33 Suppl 1:10-7. doi: 10.2165/00003495-198700331-00004. |
| Groups | Approved; Nutraceutical |
| Direct Classification | Long-chain fatty acids |
| SMILES | CCC=C/CC=C/CC=C/CC=C/CC=C/CCCC(O)=O |
| Pathways | Alpha Linolenic Acid and Linoleic Acid Metabolism |
| PharmGKB | PA164746077 |
| ChEMBL | CHEMBL460026 |
