| VIS ID | Virus | Ensembl ID | Gene Type | Target Gene | Oncogene | Tumor Suppressor Gene | NCBI ID | Uniprot ID |
|---|---|---|---|---|---|---|---|---|
| TVIS44026442 | HTLV-1 | ENSG00000012779.12 | protein_coding | ALOX5 | Yes | Yes | 240 | P09917 |
| TVIS44036453 | HTLV-1 | ENSG00000012779.12 | protein_coding | ALOX5 | Yes | Yes | 240 | P09917 |
| TVIS44046443 | HTLV-1 | ENSG00000012779.12 | protein_coding | ALOX5 | Yes | Yes | 240 | P09917 |
Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | ALOX5 |
|---|---|
| DrugBank ID | DB13174 |
| Drug Name | Rhein |
| Target ID | BE0000248 |
| UniProt ID | P09917 |
| Regulation Type | inhibitor |
| PubMed IDs | 22449441 |
| Citations | Singh B, Nadkarni JR, Vishwakarma RA, Bharate SB, Nivsarkar M, Anandjiwala S: The hydroalcoholic extract of Cassia alata (Linn.) leaves and its major compound rhein exhibits antiallergic activity via mast cell stabilization and lipoxygenase inhibition. J Ethnopharmacol. 2012 May 7;141(1):469-73. doi: 10.1016/j.jep.2012.03.012. Epub 2012 Mar 17. |
| Groups | Experimental |
| Direct Classification | Anthracenecarboxylic acids |
| SMILES | OC(=O)C1=CC2=C(C(O)=C1)C(=O)C1=C(C=CC=C1O)C2=O |
| Pathways | |
| PharmGKB | |
| ChEMBL | CHEMBL418068 |