| VIS ID | Virus | Ensembl ID | Gene Type | Target Gene | Oncogene | Tumor Suppressor Gene | NCBI ID | Uniprot ID |
|---|---|---|---|---|---|---|---|---|
| TVIS44026442 | HTLV-1 | ENSG00000012779.12 | protein_coding | ALOX5 | Yes | Yes | 240 | P09917 |
| TVIS44036453 | HTLV-1 | ENSG00000012779.12 | protein_coding | ALOX5 | Yes | Yes | 240 | P09917 |
| TVIS44046443 | HTLV-1 | ENSG00000012779.12 | protein_coding | ALOX5 | Yes | Yes | 240 | P09917 |
Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | ALOX5 |
|---|---|
| DrugBank ID | DB04725 |
| Drug Name | Licofelone |
| Target ID | BE0000248 |
| UniProt ID | P09917 |
| Regulation Type | |
| PubMed IDs | 11752352; 17015640 |
| Citations | Chen X, Ji ZL, Chen YZ: TTD: Therapeutic Target Database. Nucleic Acids Res. 2002 Jan 1;30(1):412-5.@@Vidal C, Gomez-Hernandez A, Sanchez-Galan E, Gonzalez A, Ortega L, Gomez-Gerique JA, Tunon J, Egido J: Licofelone, a balanced inhibitor of cyclooxygenase and 5-lipoxygenase, reduces inflammation in a rabbit model of atherosclerosis. J Pharmacol Exp Ther. 2007 Jan;320(1):108-16. Epub 2006 Oct 2. |
| Groups | Investigational |
| Direct Classification | Diphenylpyrroles |
| SMILES | CC1(C)CN2C(CC(O)=O)=C(C(=C2C1)C1=CC=CC=C1)C1=CC=C(Cl)C=C1 |
| Pathways | |
| PharmGKB | |
| ChEMBL | CHEMBL300982 |