| VIS ID | Virus | Ensembl ID | Gene Type | Target Gene | Oncogene | Tumor Suppressor Gene | NCBI ID | Uniprot ID |
|---|---|---|---|---|---|---|---|---|
| TVIS44026442 | HTLV-1 | ENSG00000012779.12 | protein_coding | ALOX5 | Yes | Yes | 240 | P09917 |
| TVIS44036453 | HTLV-1 | ENSG00000012779.12 | protein_coding | ALOX5 | Yes | Yes | 240 | P09917 |
| TVIS44046443 | HTLV-1 | ENSG00000012779.12 | protein_coding | ALOX5 | Yes | Yes | 240 | P09917 |
Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | ALOX5 |
|---|---|
| DrugBank ID | DB01014 |
| Drug Name | Balsalazide |
| Target ID | BE0000248 |
| UniProt ID | P09917 |
| Regulation Type | inhibitor |
| PubMed IDs | 19743890; 1359745 |
| Citations | Wiggins JB, Rajapakse R: Balsalazide: a novel 5-aminosalicylate prodrug for the treatment of active ulcerative colitis. Expert Opin Drug Metab Toxicol. 2009 Oct;5(10):1279-84. doi: 10.1517/17425250903206996.@@Rask-Madsen J, Bukhave K, Laursen LS, Lauritsen K: 5-Lipoxygenase inhibitors for the treatment of inflammatory bowel disease. Agents Actions. 1992;Spec No:C37-46. |
| Groups | Approved; Investigational |
| Direct Classification | Azobenzenes |
| SMILES | OC(=O)CCNC(=O)C1=CC=C(C=C1)N=NC1=CC=C(O)C(=C1)C(O)=O |
| Pathways | |
| PharmGKB | PA448536 |
| ChEMBL | CHEMBL1201346 |
