| VIS ID | Virus | Ensembl ID | Gene Type | Target Gene | Oncogene | Tumor Suppressor Gene | NCBI ID | Uniprot ID |
|---|---|---|---|---|---|---|---|---|
| TVIS30086012 | HIV | ENSG00000188778.6 | protein_coding | ADRB3 | No | No | 155 | A8KAG8 P13945 |
Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | ADRB3 |
|---|---|
| DrugBank ID | DB01102 |
| Drug Name | Arbutamine |
| Target ID | BE0001012 |
| UniProt ID | P13945 |
| Regulation Type | agonist |
| PubMed IDs | 8723169 |
| Citations | Abou-Mohamed G, Nagarajan R, Ibrahim TM, Caldwell RW: Characterization of the adrenergic activity of arbutamine, a novel agent for pharmacological stress testing. Cardiovasc Drugs Ther. 1996 Mar;10(1):39-47. |
| Groups | Approved |
| Direct Classification | Phenylbutylamines |
| SMILES | O[C@@H](CNCCCCC1=CC=C(O)C=C1)C1=CC(O)=C(O)C=C1 |
| Pathways | Arbutamine Action Pathway |
| PharmGKB | PA164747979 |
| ChEMBL | CHEMBL1201251 |
